C27H27N3O2S — CID 142286458
1-(3,5-dicyclopropylphenyl)-N-[(4-sulfanylphenyl)methyl]-2,3-dihydropyrido[2,3-b][1,4]oxazine-6-carboxamide (PubChem CID 142286458) has the molecular formula C27H27N3O2S and a molecular weight of 457.60 g/mol. Its IUPAC name is 1-(3,5-dicyclopropylphenyl)-N-[(4-sulfanylphenyl)methyl]-2,3-dihydropyrido[2,3-b][1,4]oxazine-6-carboxamide.
| Compound Name | 1-(3,5-dicyclopropylphenyl)-N-[(4-sulfanylphenyl)methyl]-2,3-dihydropyrido[2,3-b][1,4]oxazine-6-carboxamide |
|---|---|
| PubChem CID | 142286458 |
| Molecular Formula | C27H27N3O2S |
| Molecular Weight | 457.60 g/mol |
| Exact Mass | 457.18 |
| IUPAC Name | 1-(3,5-dicyclopropylphenyl)-N-[(4-sulfanylphenyl)methyl]-2,3-dihydropyrido[2,3-b][1,4]oxazine-6-carboxamide |
| SMILES | O=C(NCc1ccc(S)cc1)c1ccc2c(n1)OCCN2c1cc(C2CC2)cc(C2CC2)c1 |
| InChI | InChI=1S/C27H27N3O2S/c31-26(28-16-17-1-7-23(33)8-2-17)24-9-10-25-27(29-24)32-12-11-30(25)22-14-20(18-3-4-18)13-21(15-22)19-5-6-19/h1-2,7-10,13-15,18-19,33H,3-6,11-12,16H2,(H,28,31) |
| InChIKey | CGVRLADBOYWDOD-UHFFFAOYSA-N |
| XLogP | 5.59 |
| TPSA | 54.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.60 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|