About methyl N-[2-(5-amino-1,3,4-oxadiazol-2-yl)ethyl]carbamate;propane
methyl N-[2-(5-amino-1,3,4-oxadiazol-2-yl)ethyl]carbamate;propane (PubChem CID 142287204) has the molecular formula C9H18N4O3
and a molecular weight of 230.27 g/mol. Its IUPAC name is methyl N-[2-(5-amino-1,3,4-oxadiazol-2-yl)ethyl]carbamate;propane.
Molecular Properties
| Compound Name | methyl N-[2-(5-amino-1,3,4-oxadiazol-2-yl)ethyl]carbamate;propane |
| PubChem CID | 142287204 |
| Molecular Formula | C9H18N4O3 |
| Molecular Weight | 230.27 g/mol |
| Exact Mass | 230.14 |
| IUPAC Name | methyl N-[2-(5-amino-1,3,4-oxadiazol-2-yl)ethyl]carbamate;propane |
| SMILES | CCC.COC(=O)NCCc1nnc(N)o1 |
| InChI | InChI=1S/C6H10N4O3.C3H8/c1-12-6(11)8-3-2-4-9-10-5(7)13-4;1-3-2/h2-3H2,1H3,(H2,7,10)(H,8,11);3H2,1-2H3 |
| InChIKey | IQUZPXULJBTEMJ-UHFFFAOYSA-N |
| XLogP | 0.97 |
| TPSA | 103.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 230.27 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze methyl N-[2-(5-amino-1,3,4-oxadiazol-2-yl)ethyl]carbamate;propane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl N-[2-(5-amino-1,3,4-oxadiazol-2-yl)ethyl]carbamate;propane?
The IUPAC name of methyl N-[2-(5-amino-1,3,4-oxadiazol-2-yl)ethyl]carbamate;propane (CID 142287204) is methyl N-[2-(5-amino-1,3,4-oxadiazol-2-yl)ethyl]carbamate;propane.
What is the SMILES notation for methyl N-[2-(5-amino-1,3,4-oxadiazol-2-yl)ethyl]carbamate;propane?
The canonical SMILES for methyl N-[2-(5-amino-1,3,4-oxadiazol-2-yl)ethyl]carbamate;propane is CCC.COC(=O)NCCc1nnc(N)o1.
What is the InChIKey of methyl N-[2-(5-amino-1,3,4-oxadiazol-2-yl)ethyl]carbamate;propane?
The InChIKey is IQUZPXULJBTEMJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H10N4O3.C3H8/c1-12-6(11)8-3-2-4-9-10-5(7)13-4;1-3-2/h2-3H2,1H3,(H2,7,10)(H,8,11);3H2,1-2H3.
What are the key properties of methyl N-[2-(5-amino-1,3,4-oxadiazol-2-yl)ethyl]carbamate;propane?
methyl N-[2-(5-amino-1,3,4-oxadiazol-2-yl)ethyl]carbamate;propane has a molecular weight of 230.27 g/mol, XLogP of 0.97, 3 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for methyl N-[2-(5-amino-1,3,4-oxadiazol-2-yl)ethyl]carbamate;propane is sourced from PubChem (CID 142287204), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).