About methyl N-[2-[5-(methylamino)-1,3,4-oxadiazol-2-yl]ethyl]carbamate;propane
methyl N-[2-[5-(methylamino)-1,3,4-oxadiazol-2-yl]ethyl]carbamate;propane (PubChem CID 142287207) has the molecular formula C10H20N4O3
and a molecular weight of 244.29 g/mol. Its IUPAC name is methyl N-[2-[5-(methylamino)-1,3,4-oxadiazol-2-yl]ethyl]carbamate;propane.
Molecular Properties
| Compound Name | methyl N-[2-[5-(methylamino)-1,3,4-oxadiazol-2-yl]ethyl]carbamate;propane |
| PubChem CID | 142287207 |
| Molecular Formula | C10H20N4O3 |
| Molecular Weight | 244.29 g/mol |
| Exact Mass | 244.15 |
| IUPAC Name | methyl N-[2-[5-(methylamino)-1,3,4-oxadiazol-2-yl]ethyl]carbamate;propane |
| SMILES | CCC.CNc1nnc(CCNC(=O)OC)o1 |
| InChI | InChI=1S/C7H12N4O3.C3H8/c1-8-6-11-10-5(14-6)3-4-9-7(12)13-2;1-3-2/h3-4H2,1-2H3,(H,8,11)(H,9,12);3H2,1-2H3 |
| InChIKey | MJTOEIZZDTZZMS-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 89.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 244.29 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze methyl N-[2-[5-(methylamino)-1,3,4-oxadiazol-2-yl]ethyl]carbamate;propane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl N-[2-[5-(methylamino)-1,3,4-oxadiazol-2-yl]ethyl]carbamate;propane?
The IUPAC name of methyl N-[2-[5-(methylamino)-1,3,4-oxadiazol-2-yl]ethyl]carbamate;propane (CID 142287207) is methyl N-[2-[5-(methylamino)-1,3,4-oxadiazol-2-yl]ethyl]carbamate;propane.
What is the SMILES notation for methyl N-[2-[5-(methylamino)-1,3,4-oxadiazol-2-yl]ethyl]carbamate;propane?
The canonical SMILES for methyl N-[2-[5-(methylamino)-1,3,4-oxadiazol-2-yl]ethyl]carbamate;propane is CCC.CNc1nnc(CCNC(=O)OC)o1.
What is the InChIKey of methyl N-[2-[5-(methylamino)-1,3,4-oxadiazol-2-yl]ethyl]carbamate;propane?
The InChIKey is MJTOEIZZDTZZMS-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H12N4O3.C3H8/c1-8-6-11-10-5(14-6)3-4-9-7(12)13-2;1-3-2/h3-4H2,1-2H3,(H,8,11)(H,9,12);3H2,1-2H3.
What are the key properties of methyl N-[2-[5-(methylamino)-1,3,4-oxadiazol-2-yl]ethyl]carbamate;propane?
methyl N-[2-[5-(methylamino)-1,3,4-oxadiazol-2-yl]ethyl]carbamate;propane has a molecular weight of 244.29 g/mol, XLogP of 1.43, 4 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for methyl N-[2-[5-(methylamino)-1,3,4-oxadiazol-2-yl]ethyl]carbamate;propane is sourced from PubChem (CID 142287207), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).