C18H28ClN3O4 — CID 142287357
tert-butyl N-[2-[3-(3-chloro-2-nitroanilino)cyclobutyl]ethyl]-N-methylcarbamate;molecular hydrogen (PubChem CID 142287357) has the molecular formula C18H28ClN3O4 and a molecular weight of 385.89 g/mol. Its IUPAC name is tert-butyl N-[2-[3-(3-chloro-2-nitroanilino)cyclobutyl]ethyl]-N-methylcarbamate;molecular hydrogen.
| Compound Name | tert-butyl N-[2-[3-(3-chloro-2-nitroanilino)cyclobutyl]ethyl]-N-methylcarbamate;molecular hydrogen |
|---|---|
| PubChem CID | 142287357 |
| Molecular Formula | C18H28ClN3O4 |
| Molecular Weight | 385.89 g/mol |
| Exact Mass | 385.18 |
| IUPAC Name | tert-butyl N-[2-[3-(3-chloro-2-nitroanilino)cyclobutyl]ethyl]-N-methylcarbamate;molecular hydrogen |
| SMILES | CN(CCC1CC(Nc2cccc(Cl)c2[N+](=O)[O-])C1)C(=O)OC(C)(C)C.[H][H] |
| InChI | InChI=1S/C18H26ClN3O4.H2/c1-18(2,3)26-17(23)21(4)9-8-12-10-13(11-12)20-15-7-5-6-14(19)16(15)22(24)25;/h5-7,12-13,20H,8-11H2,1-4H3;1H |
| InChIKey | XCXKEGLEYSWBIO-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 84.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.89 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|