About 4-aminocyclohexan-1-one;ethane
4-aminocyclohexan-1-one;ethane (PubChem CID 142287565) has the molecular formula C8H17NO
and a molecular weight of 143.23 g/mol. Its IUPAC name is 4-aminocyclohexan-1-one;ethane.
Molecular Properties
| Compound Name | 4-aminocyclohexan-1-one;ethane |
| PubChem CID | 142287565 |
| Molecular Formula | C8H17NO |
| Molecular Weight | 143.23 g/mol |
| Exact Mass | 143.13 |
| IUPAC Name | 4-aminocyclohexan-1-one;ethane |
| SMILES | CC.NC1CCC(=O)CC1 |
| InChI | InChI=1S/C6H11NO.C2H6/c7-5-1-3-6(8)4-2-5;1-2/h5H,1-4,7H2;1-2H3 |
| InChIKey | FHFAWINYHTVPIM-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 143.23 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-aminocyclohexan-1-one;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-aminocyclohexan-1-one;ethane?
The IUPAC name of 4-aminocyclohexan-1-one;ethane (CID 142287565) is 4-aminocyclohexan-1-one;ethane.
What is the SMILES notation for 4-aminocyclohexan-1-one;ethane?
The canonical SMILES for 4-aminocyclohexan-1-one;ethane is CC.NC1CCC(=O)CC1.
What is the InChIKey of 4-aminocyclohexan-1-one;ethane?
The InChIKey is FHFAWINYHTVPIM-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H11NO.C2H6/c7-5-1-3-6(8)4-2-5;1-2/h5H,1-4,7H2;1-2H3.
What are the key properties of 4-aminocyclohexan-1-one;ethane?
4-aminocyclohexan-1-one;ethane has a molecular weight of 143.23 g/mol, XLogP of 1.48, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-aminocyclohexan-1-one;ethane is sourced from PubChem (CID 142287565), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).