About 3-methoxy-3,8a-dihydro-2H-[1,3]oxazolo[3,2-a]pyridine
3-methoxy-3,8a-dihydro-2H-[1,3]oxazolo[3,2-a]pyridine (PubChem CID 142287670) has the molecular formula C8H11NO2
and a molecular weight of 153.18 g/mol. Its IUPAC name is 3-methoxy-3,8a-dihydro-2H-[1,3]oxazolo[3,2-a]pyridine.
Analyze 3-methoxy-3,8a-dihydro-2H-[1,3]oxazolo[3,2-a]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methoxy-3,8a-dihydro-2H-[1,3]oxazolo[3,2-a]pyridine?
The IUPAC name of 3-methoxy-3,8a-dihydro-2H-[1,3]oxazolo[3,2-a]pyridine (CID 142287670) is 3-methoxy-3,8a-dihydro-2H-[1,3]oxazolo[3,2-a]pyridine.
What is the SMILES notation for 3-methoxy-3,8a-dihydro-2H-[1,3]oxazolo[3,2-a]pyridine?
The canonical SMILES for 3-methoxy-3,8a-dihydro-2H-[1,3]oxazolo[3,2-a]pyridine is COC1COC2C=CC=CN21.
What is the InChIKey of 3-methoxy-3,8a-dihydro-2H-[1,3]oxazolo[3,2-a]pyridine?
The InChIKey is UUAKVDUXGZMOHW-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H11NO2/c1-10-8-6-11-7-4-2-3-5-9(7)8/h2-5,7-8H,6H2,1H3.
What are the key properties of 3-methoxy-3,8a-dihydro-2H-[1,3]oxazolo[3,2-a]pyridine?
3-methoxy-3,8a-dihydro-2H-[1,3]oxazolo[3,2-a]pyridine has a molecular weight of 153.18 g/mol, XLogP of 0.70, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methoxy-3,8a-dihydro-2H-[1,3]oxazolo[3,2-a]pyridine is sourced from PubChem (CID 142287670), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).