C18H20 — CID 142288787
4,8,14-trimethyltricyclo[9.4.0.02,7]pentadeca-1(11),2(7),3,5,12,14-hexaene (PubChem CID 142288787) has the molecular formula C18H20 and a molecular weight of 236.36 g/mol. Its IUPAC name is 4,8,14-trimethyltricyclo[9.4.0.02,7]pentadeca-1(11),2(7),3,5,12,14-hexaene.
| Compound Name | 4,8,14-trimethyltricyclo[9.4.0.02,7]pentadeca-1(11),2(7),3,5,12,14-hexaene |
|---|---|
| PubChem CID | 142288787 |
| Molecular Formula | C18H20 |
| Molecular Weight | 236.36 g/mol |
| Exact Mass | 236.16 |
| IUPAC Name | 4,8,14-trimethyltricyclo[9.4.0.02,7]pentadeca-1(11),2(7),3,5,12,14-hexaene |
| SMILES | Cc1ccc2c(c1)-c1cc(C)ccc1C(C)CC2 |
| InChI | InChI=1S/C18H20/c1-12-4-7-15-8-6-14(3)16-9-5-13(2)11-18(16)17(15)10-12/h4-5,7,9-11,14H,6,8H2,1-3H3 |
| InChIKey | FNOOXIZTGUOHRT-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.36 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |