About imidazo[1,2-c]pyrimidine-2-thiol
imidazo[1,2-c]pyrimidine-2-thiol (PubChem CID 142289058) has the molecular formula C6H5N3S
and a molecular weight of 151.19 g/mol. Its IUPAC name is imidazo[1,2-c]pyrimidine-2-thiol.
Molecular Properties
| Compound Name | imidazo[1,2-c]pyrimidine-2-thiol |
| PubChem CID | 142289058 |
| Molecular Formula | C6H5N3S |
| Molecular Weight | 151.19 g/mol |
| Exact Mass | 151.02 |
| IUPAC Name | imidazo[1,2-c]pyrimidine-2-thiol |
| SMILES | Sc1cn2cnccc2n1 |
| InChI | InChI=1S/C6H5N3S/c10-6-3-9-4-7-2-1-5(9)8-6/h1-4,10H |
| InChIKey | WSFFZRXVXZLRTB-UHFFFAOYSA-N |
| XLogP | 1.02 |
| TPSA | 30.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 151.19 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze imidazo[1,2-c]pyrimidine-2-thiol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of imidazo[1,2-c]pyrimidine-2-thiol?
The IUPAC name of imidazo[1,2-c]pyrimidine-2-thiol (CID 142289058) is imidazo[1,2-c]pyrimidine-2-thiol.
What is the SMILES notation for imidazo[1,2-c]pyrimidine-2-thiol?
The canonical SMILES for imidazo[1,2-c]pyrimidine-2-thiol is Sc1cn2cnccc2n1.
What is the InChIKey of imidazo[1,2-c]pyrimidine-2-thiol?
The InChIKey is WSFFZRXVXZLRTB-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H5N3S/c10-6-3-9-4-7-2-1-5(9)8-6/h1-4,10H.
What are the key properties of imidazo[1,2-c]pyrimidine-2-thiol?
imidazo[1,2-c]pyrimidine-2-thiol has a molecular weight of 151.19 g/mol, XLogP of 1.02, 0 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for imidazo[1,2-c]pyrimidine-2-thiol is sourced from PubChem (CID 142289058), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).