C11H16F3N3 — CID 142289192
2-N,4-N,4-N-triethyl-3,5,6-trifluoropyridine-2,4-diamine (PubChem CID 142289192) has the molecular formula C11H16F3N3 and a molecular weight of 247.26 g/mol. Its IUPAC name is 2-N,4-N,4-N-triethyl-3,5,6-trifluoropyridine-2,4-diamine.
| Compound Name | 2-N,4-N,4-N-triethyl-3,5,6-trifluoropyridine-2,4-diamine |
|---|---|
| PubChem CID | 142289192 |
| Molecular Formula | C11H16F3N3 |
| Molecular Weight | 247.26 g/mol |
| Exact Mass | 247.13 |
| IUPAC Name | 2-N,4-N,4-N-triethyl-3,5,6-trifluoropyridine-2,4-diamine |
| SMILES | CCNc1nc(F)c(F)c(N(CC)CC)c1F |
| InChI | InChI=1S/C11H16F3N3/c1-4-15-11-8(13)9(17(5-2)6-3)7(12)10(14)16-11/h4-6H2,1-3H3,(H,15,16) |
| InChIKey | BUSXNXOBEVOBEP-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 28.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.26 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|