About 1-(1,2-dihydropyridin-6-yl)-N-methylmethanamine;ethane;(Z)-4-iminopent-2-en-1-amine
1-(1,2-dihydropyridin-6-yl)-N-methylmethanamine;ethane;(Z)-4-iminopent-2-en-1-amine (PubChem CID 142289237) has the molecular formula C14H28N4
and a molecular weight of 252.41 g/mol. Its IUPAC name is 1-(1,2-dihydropyridin-6-yl)-N-methylmethanamine;ethane;(Z)-4-iminopent-2-en-1-amine.
Molecular Properties
| Compound Name | 1-(1,2-dihydropyridin-6-yl)-N-methylmethanamine;ethane;(Z)-4-iminopent-2-en-1-amine |
| PubChem CID | 142289237 |
| Molecular Formula | C14H28N4 |
| Molecular Weight | 252.41 g/mol |
| Exact Mass | 252.23 |
| IUPAC Name | 1-(1,2-dihydropyridin-6-yl)-N-methylmethanamine;ethane;(Z)-4-iminopent-2-en-1-amine |
| SMILES | CC.CNCC1=CC=CCN1.[H]/N=C(C)/C=C\CN |
| InChI | InChI=1S/C7H12N2.C5H10N2.C2H6/c1-8-6-7-4-2-3-5-9-7;1-5(7)3-2-4-6;1-2/h2-4,8-9H,5-6H2,1H3;2-3,7H,4,6H2,1H3;1-2H3/b;3-2-,7-5+; |
| InChIKey | JWMNNJIJUMFMPF-LCMALVRUSA-N |
| XLogP | 1.82 |
| TPSA | 73.93 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 252.41 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 1-(1,2-dihydropyridin-6-yl)-N-methylmethanamine;ethane;(Z)-4-iminopent-2-en-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(1,2-dihydropyridin-6-yl)-N-methylmethanamine;ethane;(Z)-4-iminopent-2-en-1-amine?
The IUPAC name of 1-(1,2-dihydropyridin-6-yl)-N-methylmethanamine;ethane;(Z)-4-iminopent-2-en-1-amine (CID 142289237) is 1-(1,2-dihydropyridin-6-yl)-N-methylmethanamine;ethane;(Z)-4-iminopent-2-en-1-amine.
What is the SMILES notation for 1-(1,2-dihydropyridin-6-yl)-N-methylmethanamine;ethane;(Z)-4-iminopent-2-en-1-amine?
The canonical SMILES for 1-(1,2-dihydropyridin-6-yl)-N-methylmethanamine;ethane;(Z)-4-iminopent-2-en-1-amine is CC.CNCC1=CC=CCN1.[H]/N=C(C)/C=C\CN.
What is the InChIKey of 1-(1,2-dihydropyridin-6-yl)-N-methylmethanamine;ethane;(Z)-4-iminopent-2-en-1-amine?
The InChIKey is JWMNNJIJUMFMPF-LCMALVRUSA-N. The full InChI is InChI=1S/C7H12N2.C5H10N2.C2H6/c1-8-6-7-4-2-3-5-9-7;1-5(7)3-2-4-6;1-2/h2-4,8-9H,5-6H2,1H3;2-3,7H,4,6H2,1H3;1-2H3/b;3-2-,7-5+;.
What are the key properties of 1-(1,2-dihydropyridin-6-yl)-N-methylmethanamine;ethane;(Z)-4-iminopent-2-en-1-amine?
1-(1,2-dihydropyridin-6-yl)-N-methylmethanamine;ethane;(Z)-4-iminopent-2-en-1-amine has a molecular weight of 252.41 g/mol, XLogP of 1.82, 4 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(1,2-dihydropyridin-6-yl)-N-methylmethanamine;ethane;(Z)-4-iminopent-2-en-1-amine is sourced from PubChem (CID 142289237), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).