C28H30BN7O5S2 — CID 142289367
2-[(3R,6S)-3-[[5-[[2-[6-[[bis(pyridin-2-ylmethyl)amino]methyl]-3-pyridinyl]acetyl]amino]-1,3,4-thiadiazol-2-yl]sulfanyl]-2-hydroxyoxaborinan-6-yl]acetic acid (PubChem CID 142289367) has the molecular formula C28H30BN7O5S2 and a molecular weight of 619.54 g/mol. Its IUPAC name is 2-[(3R,6S)-3-[[5-[[2-[6-[[bis(pyridin-2-ylmethyl)amino]methyl]-3-pyridinyl]acetyl]amino]-1,3,4-thiadiazol-2-yl]sulfanyl]-2-hydroxyoxaborinan-6-yl]acetic acid.
| Compound Name | 2-[(3R,6S)-3-[[5-[[2-[6-[[bis(pyridin-2-ylmethyl)amino]methyl]-3-pyridinyl]acetyl]amino]-1,3,4-thiadiazol-2-yl]sulfanyl]-2-hydroxyoxaborinan-6-yl]acetic acid |
|---|---|
| PubChem CID | 142289367 |
| Molecular Formula | C28H30BN7O5S2 |
| Molecular Weight | 619.54 g/mol |
| Exact Mass | 619.18 |
| IUPAC Name | 2-[(3R,6S)-3-[[5-[[2-[6-[[bis(pyridin-2-ylmethyl)amino]methyl]-3-pyridinyl]acetyl]amino]-1,3,4-thiadiazol-2-yl]sulfanyl]-2-hydroxyoxaborinan-6-yl]acetic acid |
| SMILES | O=C(O)C[C@@H]1CC[C@H](Sc2nnc(NC(=O)Cc3ccc(CN(Cc4ccccn4)Cc4ccccn4)nc3)s2)B(O)O1 |
| InChI | InChI=1S/C28H30BN7O5S2/c37-25(33-27-34-35-28(43-27)42-24-10-9-23(14-26(38)39)41-29(24)40)13-19-7-8-22(32-15-19)18-36(16-20-5-1-3-11-30-20)17-21-6-2-4-12-31-21/h1-8,11-12,15,23-24,40H,9-10,13-14,16-18H2,(H,38,39)(H,33,34,37)/t23-,24-/m0/s1 |
| InChIKey | SZIPPNXPPSHERW-ZEQRLZLVSA-N |
| XLogP | 3.24 |
| TPSA | 163.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 619.54 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|