About 3-[5-[(1Z)-buta-1,3-dienyl]-2,6-dimethyl-1-benzothiophen-3-yl]-2-ethyl-1H-indole
3-[5-[(1Z)-buta-1,3-dienyl]-2,6-dimethyl-1-benzothiophen-3-yl]-2-ethyl-1H-indole (PubChem CID 142290623) has the molecular formula C24H23NS
and a molecular weight of 357.52 g/mol. Its IUPAC name is 3-[5-[(1Z)-buta-1,3-dienyl]-2,6-dimethyl-1-benzothiophen-3-yl]-2-ethyl-1H-indole.
Molecular Properties
| Compound Name | 3-[5-[(1Z)-buta-1,3-dienyl]-2,6-dimethyl-1-benzothiophen-3-yl]-2-ethyl-1H-indole |
| PubChem CID | 142290623 |
| Molecular Formula | C24H23NS |
| Molecular Weight | 357.52 g/mol |
| Exact Mass | 357.16 |
| IUPAC Name | 3-[5-[(1Z)-buta-1,3-dienyl]-2,6-dimethyl-1-benzothiophen-3-yl]-2-ethyl-1H-indole |
| SMILES | C=C/C=C\c1cc2c(-c3c(CC)[nH]c4ccccc34)c(C)sc2cc1C |
| InChI | InChI=1S/C24H23NS/c1-5-7-10-17-14-19-22(13-15(17)3)26-16(4)23(19)24-18-11-8-9-12-21(18)25-20(24)6-2/h5,7-14,25H,1,6H2,2-4H3/b10-7- |
| InChIKey | JLRHLROZCFNLCQ-YFHOEESVSA-N |
| XLogP | 7.43 |
| TPSA | 15.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 357.52 |
| LogP ≤ 5 | 7.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze 3-[5-[(1Z)-buta-1,3-dienyl]-2,6-dimethyl-1-benzothiophen-3-yl]-2-ethyl-1H-indole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[5-[(1Z)-buta-1,3-dienyl]-2,6-dimethyl-1-benzothiophen-3-yl]-2-ethyl-1H-indole?
The IUPAC name of 3-[5-[(1Z)-buta-1,3-dienyl]-2,6-dimethyl-1-benzothiophen-3-yl]-2-ethyl-1H-indole (CID 142290623) is 3-[5-[(1Z)-buta-1,3-dienyl]-2,6-dimethyl-1-benzothiophen-3-yl]-2-ethyl-1H-indole.
What is the SMILES notation for 3-[5-[(1Z)-buta-1,3-dienyl]-2,6-dimethyl-1-benzothiophen-3-yl]-2-ethyl-1H-indole?
The canonical SMILES for 3-[5-[(1Z)-buta-1,3-dienyl]-2,6-dimethyl-1-benzothiophen-3-yl]-2-ethyl-1H-indole is C=C/C=C\c1cc2c(-c3c(CC)[nH]c4ccccc34)c(C)sc2cc1C.
What is the InChIKey of 3-[5-[(1Z)-buta-1,3-dienyl]-2,6-dimethyl-1-benzothiophen-3-yl]-2-ethyl-1H-indole?
The InChIKey is JLRHLROZCFNLCQ-YFHOEESVSA-N. The full InChI is InChI=1S/C24H23NS/c1-5-7-10-17-14-19-22(13-15(17)3)26-16(4)23(19)24-18-11-8-9-12-21(18)25-20(24)6-2/h5,7-14,25H,1,6H2,2-4H3/b10-7-.
What are the key properties of 3-[5-[(1Z)-buta-1,3-dienyl]-2,6-dimethyl-1-benzothiophen-3-yl]-2-ethyl-1H-indole?
3-[5-[(1Z)-buta-1,3-dienyl]-2,6-dimethyl-1-benzothiophen-3-yl]-2-ethyl-1H-indole has a molecular weight of 357.52 g/mol, XLogP of 7.43, 4 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[5-[(1Z)-buta-1,3-dienyl]-2,6-dimethyl-1-benzothiophen-3-yl]-2-ethyl-1H-indole is sourced from PubChem (CID 142290623), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).