About 1-buta-1,3-dien-2-yl-2,5-dimethylpiperidine
1-buta-1,3-dien-2-yl-2,5-dimethylpiperidine (PubChem CID 142290888) has the molecular formula C11H19N
and a molecular weight of 165.28 g/mol. Its IUPAC name is 1-buta-1,3-dien-2-yl-2,5-dimethylpiperidine.
Molecular Properties
| Compound Name | 1-buta-1,3-dien-2-yl-2,5-dimethylpiperidine |
| PubChem CID | 142290888 |
| Molecular Formula | C11H19N |
| Molecular Weight | 165.28 g/mol |
| Exact Mass | 165.15 |
| IUPAC Name | 1-buta-1,3-dien-2-yl-2,5-dimethylpiperidine |
| SMILES | C=CC(=C)N1CC(C)CCC1C |
| InChI | InChI=1S/C11H19N/c1-5-10(3)12-8-9(2)6-7-11(12)4/h5,9,11H,1,3,6-8H2,2,4H3 |
| InChIKey | UQAVMBLWTNVGDJ-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 165.28 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze 1-buta-1,3-dien-2-yl-2,5-dimethylpiperidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-buta-1,3-dien-2-yl-2,5-dimethylpiperidine?
The IUPAC name of 1-buta-1,3-dien-2-yl-2,5-dimethylpiperidine (CID 142290888) is 1-buta-1,3-dien-2-yl-2,5-dimethylpiperidine.
What is the SMILES notation for 1-buta-1,3-dien-2-yl-2,5-dimethylpiperidine?
The canonical SMILES for 1-buta-1,3-dien-2-yl-2,5-dimethylpiperidine is C=CC(=C)N1CC(C)CCC1C.
What is the InChIKey of 1-buta-1,3-dien-2-yl-2,5-dimethylpiperidine?
The InChIKey is UQAVMBLWTNVGDJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H19N/c1-5-10(3)12-8-9(2)6-7-11(12)4/h5,9,11H,1,3,6-8H2,2,4H3.
What are the key properties of 1-buta-1,3-dien-2-yl-2,5-dimethylpiperidine?
1-buta-1,3-dien-2-yl-2,5-dimethylpiperidine has a molecular weight of 165.28 g/mol, XLogP of 2.81, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-buta-1,3-dien-2-yl-2,5-dimethylpiperidine is sourced from PubChem (CID 142290888), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).