About ethane;2,8,9-trimethylpurine
ethane;2,8,9-trimethylpurine (PubChem CID 142290936) has the molecular formula C12H22N4
and a molecular weight of 222.34 g/mol. Its IUPAC name is ethane;2,8,9-trimethylpurine.
Molecular Properties
| Compound Name | ethane;2,8,9-trimethylpurine |
| PubChem CID | 142290936 |
| Molecular Formula | C12H22N4 |
| Molecular Weight | 222.34 g/mol |
| Exact Mass | 222.18 |
| IUPAC Name | ethane;2,8,9-trimethylpurine |
| SMILES | CC.CC.Cc1ncc2nc(C)n(C)c2n1 |
| InChI | InChI=1S/C8H10N4.2C2H6/c1-5-9-4-7-8(10-5)12(3)6(2)11-7;2*1-2/h4H,1-3H3;2*1-2H3 |
| InChIKey | DBCPPDLHSUTRCD-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 43.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 222.34 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze ethane;2,8,9-trimethylpurine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;2,8,9-trimethylpurine?
The IUPAC name of ethane;2,8,9-trimethylpurine (CID 142290936) is ethane;2,8,9-trimethylpurine.
What is the SMILES notation for ethane;2,8,9-trimethylpurine?
The canonical SMILES for ethane;2,8,9-trimethylpurine is CC.CC.Cc1ncc2nc(C)n(C)c2n1.
What is the InChIKey of ethane;2,8,9-trimethylpurine?
The InChIKey is DBCPPDLHSUTRCD-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10N4.2C2H6/c1-5-9-4-7-8(10-5)12(3)6(2)11-7;2*1-2/h4H,1-3H3;2*1-2H3.
What are the key properties of ethane;2,8,9-trimethylpurine?
ethane;2,8,9-trimethylpurine has a molecular weight of 222.34 g/mol, XLogP of 3.03, 0 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;2,8,9-trimethylpurine is sourced from PubChem (CID 142290936), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).