C11H23N3O2 — CID 142291313
3-tert-butyl-1,2,4-oxadiazole-5-carboxamide;ethane (PubChem CID 142291313) has the molecular formula C11H23N3O2 and a molecular weight of 229.32 g/mol. Its IUPAC name is 3-tert-butyl-1,2,4-oxadiazole-5-carboxamide;ethane.
| Compound Name | 3-tert-butyl-1,2,4-oxadiazole-5-carboxamide;ethane |
|---|---|
| PubChem CID | 142291313 |
| Molecular Formula | C11H23N3O2 |
| Molecular Weight | 229.32 g/mol |
| Exact Mass | 229.18 |
| IUPAC Name | 3-tert-butyl-1,2,4-oxadiazole-5-carboxamide;ethane |
| SMILES | CC.CC.CC(C)(C)c1noc(C(N)=O)n1 |
| InChI | InChI=1S/C7H11N3O2.2C2H6/c1-7(2,3)6-9-5(4(8)11)12-10-6;2*1-2/h1-3H3,(H2,8,11);2*1-2H3 |
| InChIKey | OYTAMEBMRJCQMN-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 82.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.32 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |