About 5-fluoro-3,3,5-trimethyl-2-[(E)-prop-1-enyl]cyclohepta[b]pyrrole
5-fluoro-3,3,5-trimethyl-2-[(E)-prop-1-enyl]cyclohepta[b]pyrrole (PubChem CID 142292207) has the molecular formula C15H18FN
and a molecular weight of 231.31 g/mol. Its IUPAC name is 5-fluoro-3,3,5-trimethyl-2-[(E)-prop-1-enyl]cyclohepta[b]pyrrole.
Molecular Properties
| Compound Name | 5-fluoro-3,3,5-trimethyl-2-[(E)-prop-1-enyl]cyclohepta[b]pyrrole |
| PubChem CID | 142292207 |
| Molecular Formula | C15H18FN |
| Molecular Weight | 231.31 g/mol |
| Exact Mass | 231.14 |
| IUPAC Name | 5-fluoro-3,3,5-trimethyl-2-[(E)-prop-1-enyl]cyclohepta[b]pyrrole |
| SMILES | C/C=C/C1=NC2=CC=CC(C)(F)C=C2C1(C)C |
| InChI | InChI=1S/C15H18FN/c1-5-7-13-14(2,3)11-10-15(4,16)9-6-8-12(11)17-13/h5-10H,1-4H3/b7-5+ |
| InChIKey | PTOHFIRNVMDCGO-FNORWQNLSA-N |
| XLogP | 4.15 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 231.31 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 5-fluoro-3,3,5-trimethyl-2-[(E)-prop-1-enyl]cyclohepta[b]pyrrole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-fluoro-3,3,5-trimethyl-2-[(E)-prop-1-enyl]cyclohepta[b]pyrrole?
The IUPAC name of 5-fluoro-3,3,5-trimethyl-2-[(E)-prop-1-enyl]cyclohepta[b]pyrrole (CID 142292207) is 5-fluoro-3,3,5-trimethyl-2-[(E)-prop-1-enyl]cyclohepta[b]pyrrole.
What is the SMILES notation for 5-fluoro-3,3,5-trimethyl-2-[(E)-prop-1-enyl]cyclohepta[b]pyrrole?
The canonical SMILES for 5-fluoro-3,3,5-trimethyl-2-[(E)-prop-1-enyl]cyclohepta[b]pyrrole is C/C=C/C1=NC2=CC=CC(C)(F)C=C2C1(C)C.
What is the InChIKey of 5-fluoro-3,3,5-trimethyl-2-[(E)-prop-1-enyl]cyclohepta[b]pyrrole?
The InChIKey is PTOHFIRNVMDCGO-FNORWQNLSA-N. The full InChI is InChI=1S/C15H18FN/c1-5-7-13-14(2,3)11-10-15(4,16)9-6-8-12(11)17-13/h5-10H,1-4H3/b7-5+.
What are the key properties of 5-fluoro-3,3,5-trimethyl-2-[(E)-prop-1-enyl]cyclohepta[b]pyrrole?
5-fluoro-3,3,5-trimethyl-2-[(E)-prop-1-enyl]cyclohepta[b]pyrrole has a molecular weight of 231.31 g/mol, XLogP of 4.15, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 5-fluoro-3,3,5-trimethyl-2-[(E)-prop-1-enyl]cyclohepta[b]pyrrole is sourced from PubChem (CID 142292207), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).