About (1S)-3,3-difluorocyclohexan-1-amine;ethane
(1S)-3,3-difluorocyclohexan-1-amine;ethane (PubChem CID 142292359) has the molecular formula C8H16F2N+
and a molecular weight of 164.22 g/mol. Its IUPAC name is (1S)-3,3-difluorocyclohexan-1-amine;ethane.
Molecular Properties
| Compound Name | (1S)-3,3-difluorocyclohexan-1-amine;ethane |
| PubChem CID | 142292359 |
| Molecular Formula | C8H16F2N+ |
| Molecular Weight | 164.22 g/mol |
| Exact Mass | 164.12 |
| IUPAC Name | (1S)-3,3-difluorocyclohexan-1-amine;ethane |
| SMILES | N[C@H]1CCCC(F)(F)C1.[CH2+]C |
| InChI | InChI=1S/C6H11F2N.C2H5/c7-6(8)3-1-2-5(9)4-6;1-2/h5H,1-4,9H2;1H2,2H3/q;+1/t5-;/m0./s1 |
| InChIKey | ZCRKCADFMQGPIE-JEDNCBNOSA-N |
| XLogP | 2.36 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 164.22 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze (1S)-3,3-difluorocyclohexan-1-amine;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1S)-3,3-difluorocyclohexan-1-amine;ethane?
The IUPAC name of (1S)-3,3-difluorocyclohexan-1-amine;ethane (CID 142292359) is (1S)-3,3-difluorocyclohexan-1-amine;ethane.
What is the SMILES notation for (1S)-3,3-difluorocyclohexan-1-amine;ethane?
The canonical SMILES for (1S)-3,3-difluorocyclohexan-1-amine;ethane is N[C@H]1CCCC(F)(F)C1.[CH2+]C.
What is the InChIKey of (1S)-3,3-difluorocyclohexan-1-amine;ethane?
The InChIKey is ZCRKCADFMQGPIE-JEDNCBNOSA-N. The full InChI is InChI=1S/C6H11F2N.C2H5/c7-6(8)3-1-2-5(9)4-6;1-2/h5H,1-4,9H2;1H2,2H3/q;+1/t5-;/m0./s1.
What are the key properties of (1S)-3,3-difluorocyclohexan-1-amine;ethane?
(1S)-3,3-difluorocyclohexan-1-amine;ethane has a molecular weight of 164.22 g/mol, XLogP of 2.36, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (1S)-3,3-difluorocyclohexan-1-amine;ethane is sourced from PubChem (CID 142292359), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).