About ethane;2-methyl-[1,3]oxazolo[4,5-c]pyridin-6-amine
ethane;2-methyl-[1,3]oxazolo[4,5-c]pyridin-6-amine (PubChem CID 142292500) has the molecular formula C9H13N3O
and a molecular weight of 179.22 g/mol. Its IUPAC name is ethane;2-methyl-[1,3]oxazolo[4,5-c]pyridin-6-amine.
Molecular Properties
| Compound Name | ethane;2-methyl-[1,3]oxazolo[4,5-c]pyridin-6-amine |
| PubChem CID | 142292500 |
| Molecular Formula | C9H13N3O |
| Molecular Weight | 179.22 g/mol |
| Exact Mass | 179.11 |
| IUPAC Name | ethane;2-methyl-[1,3]oxazolo[4,5-c]pyridin-6-amine |
| SMILES | CC.Cc1nc2cnc(N)cc2o1 |
| InChI | InChI=1S/C7H7N3O.C2H6/c1-4-10-5-3-9-7(8)2-6(5)11-4;1-2/h2-3H,1H3,(H2,8,9);1-2H3 |
| InChIKey | JBTWXWWFGNLUEL-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 64.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 179.22 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze ethane;2-methyl-[1,3]oxazolo[4,5-c]pyridin-6-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;2-methyl-[1,3]oxazolo[4,5-c]pyridin-6-amine?
The IUPAC name of ethane;2-methyl-[1,3]oxazolo[4,5-c]pyridin-6-amine (CID 142292500) is ethane;2-methyl-[1,3]oxazolo[4,5-c]pyridin-6-amine.
What is the SMILES notation for ethane;2-methyl-[1,3]oxazolo[4,5-c]pyridin-6-amine?
The canonical SMILES for ethane;2-methyl-[1,3]oxazolo[4,5-c]pyridin-6-amine is CC.Cc1nc2cnc(N)cc2o1.
What is the InChIKey of ethane;2-methyl-[1,3]oxazolo[4,5-c]pyridin-6-amine?
The InChIKey is JBTWXWWFGNLUEL-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H7N3O.C2H6/c1-4-10-5-3-9-7(8)2-6(5)11-4;1-2/h2-3H,1H3,(H2,8,9);1-2H3.
What are the key properties of ethane;2-methyl-[1,3]oxazolo[4,5-c]pyridin-6-amine?
ethane;2-methyl-[1,3]oxazolo[4,5-c]pyridin-6-amine has a molecular weight of 179.22 g/mol, XLogP of 2.14, 0 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;2-methyl-[1,3]oxazolo[4,5-c]pyridin-6-amine is sourced from PubChem (CID 142292500), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).