About (Z)-2-amino-3-chloro-N-ethenyl-N'-methylbut-2-enimidamide;ethane
(Z)-2-amino-3-chloro-N-ethenyl-N'-methylbut-2-enimidamide;ethane (PubChem CID 142292806) has the molecular formula C9H18ClN3
and a molecular weight of 203.72 g/mol. Its IUPAC name is (Z)-2-amino-3-chloro-N-ethenyl-N'-methylbut-2-enimidamide;ethane.
Molecular Properties
| Compound Name | (Z)-2-amino-3-chloro-N-ethenyl-N'-methylbut-2-enimidamide;ethane |
| PubChem CID | 142292806 |
| Molecular Formula | C9H18ClN3 |
| Molecular Weight | 203.72 g/mol |
| Exact Mass | 203.12 |
| IUPAC Name | (Z)-2-amino-3-chloro-N-ethenyl-N'-methylbut-2-enimidamide;ethane |
| SMILES | C=CNC(=N\C)/C(N)=C(\C)Cl.CC |
| InChI | InChI=1S/C7H12ClN3.C2H6/c1-4-11-7(10-3)6(9)5(2)8;1-2/h4H,1,9H2,2-3H3,(H,10,11);1-2H3/b6-5-; |
| InChIKey | GVVSLVBQDAXDOI-YSMBQZINSA-N |
| XLogP | 2.20 |
| TPSA | 50.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 203.72 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze (Z)-2-amino-3-chloro-N-ethenyl-N'-methylbut-2-enimidamide;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (Z)-2-amino-3-chloro-N-ethenyl-N'-methylbut-2-enimidamide;ethane?
The IUPAC name of (Z)-2-amino-3-chloro-N-ethenyl-N'-methylbut-2-enimidamide;ethane (CID 142292806) is (Z)-2-amino-3-chloro-N-ethenyl-N'-methylbut-2-enimidamide;ethane.
What is the SMILES notation for (Z)-2-amino-3-chloro-N-ethenyl-N'-methylbut-2-enimidamide;ethane?
The canonical SMILES for (Z)-2-amino-3-chloro-N-ethenyl-N'-methylbut-2-enimidamide;ethane is C=CNC(=N\C)/C(N)=C(\C)Cl.CC.
What is the InChIKey of (Z)-2-amino-3-chloro-N-ethenyl-N'-methylbut-2-enimidamide;ethane?
The InChIKey is GVVSLVBQDAXDOI-YSMBQZINSA-N. The full InChI is InChI=1S/C7H12ClN3.C2H6/c1-4-11-7(10-3)6(9)5(2)8;1-2/h4H,1,9H2,2-3H3,(H,10,11);1-2H3/b6-5-;.
What are the key properties of (Z)-2-amino-3-chloro-N-ethenyl-N'-methylbut-2-enimidamide;ethane?
(Z)-2-amino-3-chloro-N-ethenyl-N'-methylbut-2-enimidamide;ethane has a molecular weight of 203.72 g/mol, XLogP of 2.20, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (Z)-2-amino-3-chloro-N-ethenyl-N'-methylbut-2-enimidamide;ethane is sourced from PubChem (CID 142292806), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).