About 3-imino-4-[(1S,3R)-3-methylcyclohexanecarboximidoyl]pyrazin-2-amine
3-imino-4-[(1S,3R)-3-methylcyclohexanecarboximidoyl]pyrazin-2-amine (PubChem CID 142292828) has the molecular formula C12H19N5
and a molecular weight of 233.32 g/mol. Its IUPAC name is 3-imino-4-[(1S,3R)-3-methylcyclohexanecarboximidoyl]pyrazin-2-amine.
Molecular Properties
| Compound Name | 3-imino-4-[(1S,3R)-3-methylcyclohexanecarboximidoyl]pyrazin-2-amine |
| PubChem CID | 142292828 |
| Molecular Formula | C12H19N5 |
| Molecular Weight | 233.32 g/mol |
| Exact Mass | 233.16 |
| IUPAC Name | 3-imino-4-[(1S,3R)-3-methylcyclohexanecarboximidoyl]pyrazin-2-amine |
| SMILES | [H]/N=C(\[C@H]1CCC[C@@H](C)C1)n1ccnc(N)/c1=N\[H] |
| InChI | InChI=1S/C12H19N5/c1-8-3-2-4-9(7-8)11(14)17-6-5-16-10(13)12(17)15/h5-6,8-9,14-15H,2-4,7H2,1H3,(H2,13,16)/b14-11+,15-12+/t8-,9+/m1/s1 |
| InChIKey | HBVJLDFTIXAVNZ-SLKFBQRCSA-N |
| XLogP | 1.60 |
| TPSA | 91.54 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 233.32 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze 3-imino-4-[(1S,3R)-3-methylcyclohexanecarboximidoyl]pyrazin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-imino-4-[(1S,3R)-3-methylcyclohexanecarboximidoyl]pyrazin-2-amine?
The IUPAC name of 3-imino-4-[(1S,3R)-3-methylcyclohexanecarboximidoyl]pyrazin-2-amine (CID 142292828) is 3-imino-4-[(1S,3R)-3-methylcyclohexanecarboximidoyl]pyrazin-2-amine.
What is the SMILES notation for 3-imino-4-[(1S,3R)-3-methylcyclohexanecarboximidoyl]pyrazin-2-amine?
The canonical SMILES for 3-imino-4-[(1S,3R)-3-methylcyclohexanecarboximidoyl]pyrazin-2-amine is [H]/N=C(\[C@H]1CCC[C@@H](C)C1)n1ccnc(N)/c1=N\[H].
What is the InChIKey of 3-imino-4-[(1S,3R)-3-methylcyclohexanecarboximidoyl]pyrazin-2-amine?
The InChIKey is HBVJLDFTIXAVNZ-SLKFBQRCSA-N. The full InChI is InChI=1S/C12H19N5/c1-8-3-2-4-9(7-8)11(14)17-6-5-16-10(13)12(17)15/h5-6,8-9,14-15H,2-4,7H2,1H3,(H2,13,16)/b14-11+,15-12+/t8-,9+/m1/s1.
What are the key properties of 3-imino-4-[(1S,3R)-3-methylcyclohexanecarboximidoyl]pyrazin-2-amine?
3-imino-4-[(1S,3R)-3-methylcyclohexanecarboximidoyl]pyrazin-2-amine has a molecular weight of 233.32 g/mol, XLogP of 1.60, 1 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-imino-4-[(1S,3R)-3-methylcyclohexanecarboximidoyl]pyrazin-2-amine is sourced from PubChem (CID 142292828), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).