About 3-chloro-1-(3,3-difluoro-5,5-dimethylcyclohexanecarboximidoyl)pyrazin-2-imine
3-chloro-1-(3,3-difluoro-5,5-dimethylcyclohexanecarboximidoyl)pyrazin-2-imine (PubChem CID 142292838) has the molecular formula C13H17ClF2N4
and a molecular weight of 302.76 g/mol. Its IUPAC name is 3-chloro-1-(3,3-difluoro-5,5-dimethylcyclohexanecarboximidoyl)pyrazin-2-imine.
Molecular Properties
| Compound Name | 3-chloro-1-(3,3-difluoro-5,5-dimethylcyclohexanecarboximidoyl)pyrazin-2-imine |
| PubChem CID | 142292838 |
| Molecular Formula | C13H17ClF2N4 |
| Molecular Weight | 302.76 g/mol |
| Exact Mass | 302.11 |
| IUPAC Name | 3-chloro-1-(3,3-difluoro-5,5-dimethylcyclohexanecarboximidoyl)pyrazin-2-imine |
| SMILES | [H]/N=C(/C1CC(C)(C)CC(F)(F)C1)n1ccnc(Cl)/c1=N\[H] |
| InChI | InChI=1S/C13H17ClF2N4/c1-12(2)5-8(6-13(15,16)7-12)10(17)20-4-3-19-9(14)11(20)18/h3-4,8,17-18H,5-7H2,1-2H3/b17-10-,18-11+ |
| InChIKey | PNMJEBQTNGMCOA-ICFDZUSXSA-N |
| XLogP | 3.30 |
| TPSA | 65.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 302.76 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze 3-chloro-1-(3,3-difluoro-5,5-dimethylcyclohexanecarboximidoyl)pyrazin-2-imine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-chloro-1-(3,3-difluoro-5,5-dimethylcyclohexanecarboximidoyl)pyrazin-2-imine?
The IUPAC name of 3-chloro-1-(3,3-difluoro-5,5-dimethylcyclohexanecarboximidoyl)pyrazin-2-imine (CID 142292838) is 3-chloro-1-(3,3-difluoro-5,5-dimethylcyclohexanecarboximidoyl)pyrazin-2-imine.
What is the SMILES notation for 3-chloro-1-(3,3-difluoro-5,5-dimethylcyclohexanecarboximidoyl)pyrazin-2-imine?
The canonical SMILES for 3-chloro-1-(3,3-difluoro-5,5-dimethylcyclohexanecarboximidoyl)pyrazin-2-imine is [H]/N=C(/C1CC(C)(C)CC(F)(F)C1)n1ccnc(Cl)/c1=N\[H].
What is the InChIKey of 3-chloro-1-(3,3-difluoro-5,5-dimethylcyclohexanecarboximidoyl)pyrazin-2-imine?
The InChIKey is PNMJEBQTNGMCOA-ICFDZUSXSA-N. The full InChI is InChI=1S/C13H17ClF2N4/c1-12(2)5-8(6-13(15,16)7-12)10(17)20-4-3-19-9(14)11(20)18/h3-4,8,17-18H,5-7H2,1-2H3/b17-10-,18-11+.
What are the key properties of 3-chloro-1-(3,3-difluoro-5,5-dimethylcyclohexanecarboximidoyl)pyrazin-2-imine?
3-chloro-1-(3,3-difluoro-5,5-dimethylcyclohexanecarboximidoyl)pyrazin-2-imine has a molecular weight of 302.76 g/mol, XLogP of 3.30, 1 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-chloro-1-(3,3-difluoro-5,5-dimethylcyclohexanecarboximidoyl)pyrazin-2-imine is sourced from PubChem (CID 142292838), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).