About 4-chloro-2-(trifluoromethyl)pyrimidin-5-amine;N-methylcyclohexanamine
4-chloro-2-(trifluoromethyl)pyrimidin-5-amine;N-methylcyclohexanamine (PubChem CID 142292861) has the molecular formula C12H18ClF3N4
and a molecular weight of 310.75 g/mol. Its IUPAC name is 4-chloro-2-(trifluoromethyl)pyrimidin-5-amine;N-methylcyclohexanamine.
Molecular Properties
| Compound Name | 4-chloro-2-(trifluoromethyl)pyrimidin-5-amine;N-methylcyclohexanamine |
| PubChem CID | 142292861 |
| Molecular Formula | C12H18ClF3N4 |
| Molecular Weight | 310.75 g/mol |
| Exact Mass | 310.12 |
| IUPAC Name | 4-chloro-2-(trifluoromethyl)pyrimidin-5-amine;N-methylcyclohexanamine |
| SMILES | CNC1CCCCC1.Nc1cnc(C(F)(F)F)nc1Cl |
| InChI | InChI=1S/C7H15N.C5H3ClF3N3/c1-8-7-5-3-2-4-6-7;6-3-2(10)1-11-4(12-3)5(7,8)9/h7-8H,2-6H2,1H3;1H,10H2 |
| InChIKey | DGVLZKKQIVXSSH-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 310.75 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-chloro-2-(trifluoromethyl)pyrimidin-5-amine;N-methylcyclohexanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-chloro-2-(trifluoromethyl)pyrimidin-5-amine;N-methylcyclohexanamine?
The IUPAC name of 4-chloro-2-(trifluoromethyl)pyrimidin-5-amine;N-methylcyclohexanamine (CID 142292861) is 4-chloro-2-(trifluoromethyl)pyrimidin-5-amine;N-methylcyclohexanamine.
What is the SMILES notation for 4-chloro-2-(trifluoromethyl)pyrimidin-5-amine;N-methylcyclohexanamine?
The canonical SMILES for 4-chloro-2-(trifluoromethyl)pyrimidin-5-amine;N-methylcyclohexanamine is CNC1CCCCC1.Nc1cnc(C(F)(F)F)nc1Cl.
What is the InChIKey of 4-chloro-2-(trifluoromethyl)pyrimidin-5-amine;N-methylcyclohexanamine?
The InChIKey is DGVLZKKQIVXSSH-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H15N.C5H3ClF3N3/c1-8-7-5-3-2-4-6-7;6-3-2(10)1-11-4(12-3)5(7,8)9/h7-8H,2-6H2,1H3;1H,10H2.
What are the key properties of 4-chloro-2-(trifluoromethyl)pyrimidin-5-amine;N-methylcyclohexanamine?
4-chloro-2-(trifluoromethyl)pyrimidin-5-amine;N-methylcyclohexanamine has a molecular weight of 310.75 g/mol, XLogP of 3.27, 1 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-chloro-2-(trifluoromethyl)pyrimidin-5-amine;N-methylcyclohexanamine is sourced from PubChem (CID 142292861), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).