About 4-(3,3-difluoro-5-methylcyclohexanecarboximidoyl)-3-iminopyrazin-2-amine
4-(3,3-difluoro-5-methylcyclohexanecarboximidoyl)-3-iminopyrazin-2-amine (PubChem CID 142292899) has the molecular formula C12H17F2N5
and a molecular weight of 269.30 g/mol. Its IUPAC name is 4-(3,3-difluoro-5-methylcyclohexanecarboximidoyl)-3-iminopyrazin-2-amine.
Molecular Properties
| Compound Name | 4-(3,3-difluoro-5-methylcyclohexanecarboximidoyl)-3-iminopyrazin-2-amine |
| PubChem CID | 142292899 |
| Molecular Formula | C12H17F2N5 |
| Molecular Weight | 269.30 g/mol |
| Exact Mass | 269.15 |
| IUPAC Name | 4-(3,3-difluoro-5-methylcyclohexanecarboximidoyl)-3-iminopyrazin-2-amine |
| SMILES | [H]/N=C(\C1CC(C)CC(F)(F)C1)n1ccnc(N)/c1=N\[H] |
| InChI | InChI=1S/C12H17F2N5/c1-7-4-8(6-12(13,14)5-7)10(16)19-3-2-18-9(15)11(19)17/h2-3,7-8,16-17H,4-6H2,1H3,(H2,15,18)/b16-10+,17-11+ |
| InChIKey | REZDKUZNODLZET-OTYYAQKOSA-N |
| XLogP | 1.84 |
| TPSA | 91.54 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 269.30 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze 4-(3,3-difluoro-5-methylcyclohexanecarboximidoyl)-3-iminopyrazin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(3,3-difluoro-5-methylcyclohexanecarboximidoyl)-3-iminopyrazin-2-amine?
The IUPAC name of 4-(3,3-difluoro-5-methylcyclohexanecarboximidoyl)-3-iminopyrazin-2-amine (CID 142292899) is 4-(3,3-difluoro-5-methylcyclohexanecarboximidoyl)-3-iminopyrazin-2-amine.
What is the SMILES notation for 4-(3,3-difluoro-5-methylcyclohexanecarboximidoyl)-3-iminopyrazin-2-amine?
The canonical SMILES for 4-(3,3-difluoro-5-methylcyclohexanecarboximidoyl)-3-iminopyrazin-2-amine is [H]/N=C(\C1CC(C)CC(F)(F)C1)n1ccnc(N)/c1=N\[H].
What is the InChIKey of 4-(3,3-difluoro-5-methylcyclohexanecarboximidoyl)-3-iminopyrazin-2-amine?
The InChIKey is REZDKUZNODLZET-OTYYAQKOSA-N. The full InChI is InChI=1S/C12H17F2N5/c1-7-4-8(6-12(13,14)5-7)10(16)19-3-2-18-9(15)11(19)17/h2-3,7-8,16-17H,4-6H2,1H3,(H2,15,18)/b16-10+,17-11+.
What are the key properties of 4-(3,3-difluoro-5-methylcyclohexanecarboximidoyl)-3-iminopyrazin-2-amine?
4-(3,3-difluoro-5-methylcyclohexanecarboximidoyl)-3-iminopyrazin-2-amine has a molecular weight of 269.30 g/mol, XLogP of 1.84, 1 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(3,3-difluoro-5-methylcyclohexanecarboximidoyl)-3-iminopyrazin-2-amine is sourced from PubChem (CID 142292899), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).