About methanamine;4-N-[4-(trifluoromethyl)cyclohexyl]pyrimidine-4,5-diamine
methanamine;4-N-[4-(trifluoromethyl)cyclohexyl]pyrimidine-4,5-diamine (PubChem CID 142292904) has the molecular formula C12H20F3N5
and a molecular weight of 291.32 g/mol. Its IUPAC name is methanamine;4-N-[4-(trifluoromethyl)cyclohexyl]pyrimidine-4,5-diamine.
Molecular Properties
| Compound Name | methanamine;4-N-[4-(trifluoromethyl)cyclohexyl]pyrimidine-4,5-diamine |
| PubChem CID | 142292904 |
| Molecular Formula | C12H20F3N5 |
| Molecular Weight | 291.32 g/mol |
| Exact Mass | 291.17 |
| IUPAC Name | methanamine;4-N-[4-(trifluoromethyl)cyclohexyl]pyrimidine-4,5-diamine |
| SMILES | CN.Nc1cncnc1NC1CCC(C(F)(F)F)CC1 |
| InChI | InChI=1S/C11H15F3N4.CH5N/c12-11(13,14)7-1-3-8(4-2-7)18-10-9(15)5-16-6-17-10;1-2/h5-8H,1-4,15H2,(H,16,17,18);2H2,1H3 |
| InChIKey | WKGRKVJQMBIGIY-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 89.85 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 291.32 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze methanamine;4-N-[4-(trifluoromethyl)cyclohexyl]pyrimidine-4,5-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methanamine;4-N-[4-(trifluoromethyl)cyclohexyl]pyrimidine-4,5-diamine?
The IUPAC name of methanamine;4-N-[4-(trifluoromethyl)cyclohexyl]pyrimidine-4,5-diamine (CID 142292904) is methanamine;4-N-[4-(trifluoromethyl)cyclohexyl]pyrimidine-4,5-diamine.
What is the SMILES notation for methanamine;4-N-[4-(trifluoromethyl)cyclohexyl]pyrimidine-4,5-diamine?
The canonical SMILES for methanamine;4-N-[4-(trifluoromethyl)cyclohexyl]pyrimidine-4,5-diamine is CN.Nc1cncnc1NC1CCC(C(F)(F)F)CC1.
What is the InChIKey of methanamine;4-N-[4-(trifluoromethyl)cyclohexyl]pyrimidine-4,5-diamine?
The InChIKey is WKGRKVJQMBIGIY-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H15F3N4.CH5N/c12-11(13,14)7-1-3-8(4-2-7)18-10-9(15)5-16-6-17-10;1-2/h5-8H,1-4,15H2,(H,16,17,18);2H2,1H3.
What are the key properties of methanamine;4-N-[4-(trifluoromethyl)cyclohexyl]pyrimidine-4,5-diamine?
methanamine;4-N-[4-(trifluoromethyl)cyclohexyl]pyrimidine-4,5-diamine has a molecular weight of 291.32 g/mol, XLogP of 2.17, 2 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methanamine;4-N-[4-(trifluoromethyl)cyclohexyl]pyrimidine-4,5-diamine is sourced from PubChem (CID 142292904), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).