About butane;4-(3,3-difluoro-5-methylcyclohexanecarboximidoyl)-3-iminopyrazin-2-amine;ethane
butane;4-(3,3-difluoro-5-methylcyclohexanecarboximidoyl)-3-iminopyrazin-2-amine;ethane (PubChem CID 142292917) has the molecular formula C18H33F2N5
and a molecular weight of 357.49 g/mol. Its IUPAC name is butane;4-(3,3-difluoro-5-methylcyclohexanecarboximidoyl)-3-iminopyrazin-2-amine;ethane.
Molecular Properties
| Compound Name | butane;4-(3,3-difluoro-5-methylcyclohexanecarboximidoyl)-3-iminopyrazin-2-amine;ethane |
| PubChem CID | 142292917 |
| Molecular Formula | C18H33F2N5 |
| Molecular Weight | 357.49 g/mol |
| Exact Mass | 357.27 |
| IUPAC Name | butane;4-(3,3-difluoro-5-methylcyclohexanecarboximidoyl)-3-iminopyrazin-2-amine;ethane |
| SMILES | CC.CCCC.[H]/N=C(\C1CC(C)CC(F)(F)C1)n1ccnc(N)/c1=N\[H] |
| InChI | InChI=1S/C12H17F2N5.C4H10.C2H6/c1-7-4-8(6-12(13,14)5-7)10(16)19-3-2-18-9(15)11(19)17;1-3-4-2;1-2/h2-3,7-8,16-17H,4-6H2,1H3,(H2,15,18);3-4H2,1-2H3;1-2H3/b16-10+,17-11+;; |
| InChIKey | FIXQUMGRXGGMBO-BSUHMQRQSA-N |
| XLogP | 4.67 |
| TPSA | 91.54 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 357.49 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze butane;4-(3,3-difluoro-5-methylcyclohexanecarboximidoyl)-3-iminopyrazin-2-amine;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of butane;4-(3,3-difluoro-5-methylcyclohexanecarboximidoyl)-3-iminopyrazin-2-amine;ethane?
The IUPAC name of butane;4-(3,3-difluoro-5-methylcyclohexanecarboximidoyl)-3-iminopyrazin-2-amine;ethane (CID 142292917) is butane;4-(3,3-difluoro-5-methylcyclohexanecarboximidoyl)-3-iminopyrazin-2-amine;ethane.
What is the SMILES notation for butane;4-(3,3-difluoro-5-methylcyclohexanecarboximidoyl)-3-iminopyrazin-2-amine;ethane?
The canonical SMILES for butane;4-(3,3-difluoro-5-methylcyclohexanecarboximidoyl)-3-iminopyrazin-2-amine;ethane is CC.CCCC.[H]/N=C(\C1CC(C)CC(F)(F)C1)n1ccnc(N)/c1=N\[H].
What is the InChIKey of butane;4-(3,3-difluoro-5-methylcyclohexanecarboximidoyl)-3-iminopyrazin-2-amine;ethane?
The InChIKey is FIXQUMGRXGGMBO-BSUHMQRQSA-N. The full InChI is InChI=1S/C12H17F2N5.C4H10.C2H6/c1-7-4-8(6-12(13,14)5-7)10(16)19-3-2-18-9(15)11(19)17;1-3-4-2;1-2/h2-3,7-8,16-17H,4-6H2,1H3,(H2,15,18);3-4H2,1-2H3;1-2H3/b16-10+,17-11+;;.
What are the key properties of butane;4-(3,3-difluoro-5-methylcyclohexanecarboximidoyl)-3-iminopyrazin-2-amine;ethane?
butane;4-(3,3-difluoro-5-methylcyclohexanecarboximidoyl)-3-iminopyrazin-2-amine;ethane has a molecular weight of 357.49 g/mol, XLogP of 4.67, 2 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for butane;4-(3,3-difluoro-5-methylcyclohexanecarboximidoyl)-3-iminopyrazin-2-amine;ethane is sourced from PubChem (CID 142292917), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).