C15H19F2N5S — CID 14229325
4-[(3,5-difluorophenyl)methyl]-3-[(4-methylpiperazin-1-yl)methyl]-1H-1,2,4-triazole-5-thione (PubChem CID 14229325) has the molecular formula C15H19F2N5S and a molecular weight of 339.42 g/mol. Its IUPAC name is 4-[(3,5-difluorophenyl)methyl]-3-[(4-methylpiperazin-1-yl)methyl]-1H-1,2,4-triazole-5-thione.
| Compound Name | 4-[(3,5-difluorophenyl)methyl]-3-[(4-methylpiperazin-1-yl)methyl]-1H-1,2,4-triazole-5-thione |
|---|---|
| PubChem CID | 14229325 |
| Molecular Formula | C15H19F2N5S |
| Molecular Weight | 339.42 g/mol |
| Exact Mass | 339.13 |
| IUPAC Name | 4-[(3,5-difluorophenyl)methyl]-3-[(4-methylpiperazin-1-yl)methyl]-1H-1,2,4-triazole-5-thione |
| SMILES | CN1CCN(Cc2n[nH]c(=S)n2Cc2cc(F)cc(F)c2)CC1 |
| InChI | InChI=1S/C15H19F2N5S/c1-20-2-4-21(5-3-20)10-14-18-19-15(23)22(14)9-11-6-12(16)8-13(17)7-11/h6-8H,2-5,9-10H2,1H3,(H,19,23) |
| InChIKey | WHXBUJAMYMWZJT-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 40.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.42 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|