C55H48N4 — CID 142293276
(1Z,3Z,5E)-N'-[4-(10-cyclohexa-2,4-dien-1-ylspiro[acridine-9,11'-benzo[a]fluorene]-9'-yl)phenyl]-7-phenylhepta-1,3,5-triene-1,7-diamine;methanamine (PubChem CID 142293276) has the molecular formula C55H48N4 and a molecular weight of 765.02 g/mol. Its IUPAC name is (1Z,3Z,5E)-N'-[4-(10-cyclohexa-2,4-dien-1-ylspiro[acridine-9,11'-benzo[a]fluorene]-9'-yl)phenyl]-7-phenylhepta-1,3,5-triene-1,7-diamine;methanamine.
| Compound Name | (1Z,3Z,5E)-N'-[4-(10-cyclohexa-2,4-dien-1-ylspiro[acridine-9,11'-benzo[a]fluorene]-9'-yl)phenyl]-7-phenylhepta-1,3,5-triene-1,7-diamine;methanamine |
|---|---|
| PubChem CID | 142293276 |
| Molecular Formula | C55H48N4 |
| Molecular Weight | 765.02 g/mol |
| Exact Mass | 764.39 |
| IUPAC Name | (1Z,3Z,5E)-N'-[4-(10-cyclohexa-2,4-dien-1-ylspiro[acridine-9,11'-benzo[a]fluorene]-9'-yl)phenyl]-7-phenylhepta-1,3,5-triene-1,7-diamine;methanamine |
| SMILES | CN.N/C=C\C=C/C=C/C(Nc1ccc(-c2ccc3c(c2)C2(c4ccccc4N(C4C=CC=CC4)c4ccccc42)c2c-3ccc3ccccc23)cc1)c1ccccc1 |
| InChI | InChI=1S/C54H43N3.CH5N/c55-36-16-2-1-9-25-50(40-18-5-3-6-19-40)56-42-32-28-38(29-33-42)41-31-34-45-46-35-30-39-17-10-11-22-44(39)53(46)54(49(45)37-41)47-23-12-14-26-51(47)57(43-20-7-4-8-21-43)52-27-15-13-24-48(52)54;1-2/h1-20,22-37,43,50,56H,21,55H2;2H2,1H3/b2-1-,25-9+,36-16-; |
| InChIKey | RWZSBMDVQDYWIU-PFUFGIJCSA-N |
| XLogP | 12.52 |
| TPSA | 67.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 59 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 765.02 |
| LogP ≤ 5 | 12.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|