C48H33N3S — CID 142294011
2-[3-[3-(3-naphtho[2,3-b][1]benzothiol-2-ylphenyl)phenyl]phenyl]-4-[(3E)-penta-1,3-dien-3-yl]-6-phenyl-1,3,5-triazine (PubChem CID 142294011) has the molecular formula C48H33N3S and a molecular weight of 683.88 g/mol. Its IUPAC name is 2-[3-[3-(3-naphtho[2,3-b][1]benzothiol-2-ylphenyl)phenyl]phenyl]-4-[(3E)-penta-1,3-dien-3-yl]-6-phenyl-1,3,5-triazine.
| Compound Name | 2-[3-[3-(3-naphtho[2,3-b][1]benzothiol-2-ylphenyl)phenyl]phenyl]-4-[(3E)-penta-1,3-dien-3-yl]-6-phenyl-1,3,5-triazine |
|---|---|
| PubChem CID | 142294011 |
| Molecular Formula | C48H33N3S |
| Molecular Weight | 683.88 g/mol |
| Exact Mass | 683.24 |
| IUPAC Name | 2-[3-[3-(3-naphtho[2,3-b][1]benzothiol-2-ylphenyl)phenyl]phenyl]-4-[(3E)-penta-1,3-dien-3-yl]-6-phenyl-1,3,5-triazine |
| SMILES | C=C/C(=C\C)c1nc(-c2ccccc2)nc(-c2cccc(-c3cccc(-c4cccc(-c5ccc6sc7cc8ccccc8cc7c6c5)c4)c3)c2)n1 |
| InChI | InChI=1S/C48H33N3S/c1-3-31(4-2)46-49-47(32-13-6-5-7-14-32)51-48(50-46)41-22-12-21-37(27-41)35-19-10-17-33(25-35)34-18-11-20-36(26-34)40-23-24-44-42(29-40)43-28-38-15-8-9-16-39(38)30-45(43)52-44/h3-30H,1H2,2H3/b31-4+ |
| InChIKey | QIPFMYRSRMSJHT-ILZYZTJVSA-N |
| XLogP | 13.32 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 683.88 |
| LogP ≤ 5 | 13.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|