C14H22FN — CID 142294943
(3S)-1-[(2E,4E)-4-fluoro-6-methylhepta-2,4,6-trien-3-yl]-3-methylpiperidine (PubChem CID 142294943) has the molecular formula C14H22FN and a molecular weight of 223.34 g/mol. Its IUPAC name is (3S)-1-[(2E,4E)-4-fluoro-6-methylhepta-2,4,6-trien-3-yl]-3-methylpiperidine.
| Compound Name | (3S)-1-[(2E,4E)-4-fluoro-6-methylhepta-2,4,6-trien-3-yl]-3-methylpiperidine |
|---|---|
| PubChem CID | 142294943 |
| Molecular Formula | C14H22FN |
| Molecular Weight | 223.34 g/mol |
| Exact Mass | 223.17 |
| IUPAC Name | (3S)-1-[(2E,4E)-4-fluoro-6-methylhepta-2,4,6-trien-3-yl]-3-methylpiperidine |
| SMILES | C=C(C)/C=C(F)\C(=C/C)N1CCC[C@H](C)C1 |
| InChI | InChI=1S/C14H22FN/c1-5-14(13(15)9-11(2)3)16-8-6-7-12(4)10-16/h5,9,12H,2,6-8,10H2,1,3-4H3/b13-9+,14-5-/t12-/m0/s1 |
| InChIKey | VIDGRAOROLLPOL-GEVQQRNASA-N |
| XLogP | 4.05 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.34 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|