C25H31N7O3 — CID 142295116
1-[2-[[1-[(Z)-1-amino-2-hydrazinylethenyl]cyclopropyl]amino]-2-oxoacetyl]-N-(3-cyanophenyl)-2-methyl-6,7-dihydro-5H-pyrrolizine-3-carboxamide;ethane (PubChem CID 142295116) has the molecular formula C25H31N7O3 and a molecular weight of 477.57 g/mol. Its IUPAC name is 1-[2-[[1-[(Z)-1-amino-2-hydrazinylethenyl]cyclopropyl]amino]-2-oxoacetyl]-N-(3-cyanophenyl)-2-methyl-6,7-dihydro-5H-pyrrolizine-3-carboxamide;ethane.
| Compound Name | 1-[2-[[1-[(Z)-1-amino-2-hydrazinylethenyl]cyclopropyl]amino]-2-oxoacetyl]-N-(3-cyanophenyl)-2-methyl-6,7-dihydro-5H-pyrrolizine-3-carboxamide;ethane |
|---|---|
| PubChem CID | 142295116 |
| Molecular Formula | C25H31N7O3 |
| Molecular Weight | 477.57 g/mol |
| Exact Mass | 477.25 |
| IUPAC Name | 1-[2-[[1-[(Z)-1-amino-2-hydrazinylethenyl]cyclopropyl]amino]-2-oxoacetyl]-N-(3-cyanophenyl)-2-methyl-6,7-dihydro-5H-pyrrolizine-3-carboxamide;ethane |
| SMILES | CC.Cc1c(C(=O)C(=O)NC2(/C(N)=C/NN)CC2)c2n(c1C(=O)Nc1cccc(C#N)c1)CCC2 |
| InChI | InChI=1S/C23H25N7O3.C2H6/c1-13-18(20(31)22(33)29-23(7-8-23)17(25)12-27-26)16-6-3-9-30(16)19(13)21(32)28-15-5-2-4-14(10-15)11-24;1-2/h2,4-5,10,12,27H,3,6-9,25-26H2,1H3,(H,28,32)(H,29,33);1-2H3/b17-12-; |
| InChIKey | AKCBRUAZZKOMSV-HBPAQXCTSA-N |
| XLogP | 1.99 |
| TPSA | 168.06 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.57 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|