About N-[(3,3-difluorocyclobutyl)methyl]-3-methyl-1,1-dioxothietan-3-amine
N-[(3,3-difluorocyclobutyl)methyl]-3-methyl-1,1-dioxothietan-3-amine (PubChem CID 142295187) has the molecular formula C9H15F2NO2S
and a molecular weight of 239.29 g/mol. Its IUPAC name is N-[(3,3-difluorocyclobutyl)methyl]-3-methyl-1,1-dioxothietan-3-amine.
Molecular Properties
| Compound Name | N-[(3,3-difluorocyclobutyl)methyl]-3-methyl-1,1-dioxothietan-3-amine |
| PubChem CID | 142295187 |
| Molecular Formula | C9H15F2NO2S |
| Molecular Weight | 239.29 g/mol |
| Exact Mass | 239.08 |
| IUPAC Name | N-[(3,3-difluorocyclobutyl)methyl]-3-methyl-1,1-dioxothietan-3-amine |
| SMILES | CC1(NCC2CC(F)(F)C2)CS(=O)(=O)C1 |
| InChI | InChI=1S/C9H15F2NO2S/c1-8(5-15(13,14)6-8)12-4-7-2-9(10,11)3-7/h7,12H,2-6H2,1H3 |
| InChIKey | SPGSKGSATRVIAM-UHFFFAOYSA-N |
| XLogP | 0.81 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 239.29 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-[(3,3-difluorocyclobutyl)methyl]-3-methyl-1,1-dioxothietan-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(3,3-difluorocyclobutyl)methyl]-3-methyl-1,1-dioxothietan-3-amine?
The IUPAC name of N-[(3,3-difluorocyclobutyl)methyl]-3-methyl-1,1-dioxothietan-3-amine (CID 142295187) is N-[(3,3-difluorocyclobutyl)methyl]-3-methyl-1,1-dioxothietan-3-amine.
What is the SMILES notation for N-[(3,3-difluorocyclobutyl)methyl]-3-methyl-1,1-dioxothietan-3-amine?
The canonical SMILES for N-[(3,3-difluorocyclobutyl)methyl]-3-methyl-1,1-dioxothietan-3-amine is CC1(NCC2CC(F)(F)C2)CS(=O)(=O)C1.
What is the InChIKey of N-[(3,3-difluorocyclobutyl)methyl]-3-methyl-1,1-dioxothietan-3-amine?
The InChIKey is SPGSKGSATRVIAM-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H15F2NO2S/c1-8(5-15(13,14)6-8)12-4-7-2-9(10,11)3-7/h7,12H,2-6H2,1H3.
What are the key properties of N-[(3,3-difluorocyclobutyl)methyl]-3-methyl-1,1-dioxothietan-3-amine?
N-[(3,3-difluorocyclobutyl)methyl]-3-methyl-1,1-dioxothietan-3-amine has a molecular weight of 239.29 g/mol, XLogP of 0.81, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(3,3-difluorocyclobutyl)methyl]-3-methyl-1,1-dioxothietan-3-amine is sourced from PubChem (CID 142295187), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).