C19H37F3N6O2 — CID 142295290
1-[4-[3-(methylamino)propylamino]-6-propan-2-yl-1,3-diazinan-2-yl]-3-[4-(trifluoromethoxy)cyclohexyl]urea (PubChem CID 142295290) has the molecular formula C19H37F3N6O2 and a molecular weight of 438.54 g/mol. Its IUPAC name is 1-[4-[3-(methylamino)propylamino]-6-propan-2-yl-1,3-diazinan-2-yl]-3-[4-(trifluoromethoxy)cyclohexyl]urea.
| Compound Name | 1-[4-[3-(methylamino)propylamino]-6-propan-2-yl-1,3-diazinan-2-yl]-3-[4-(trifluoromethoxy)cyclohexyl]urea |
|---|---|
| PubChem CID | 142295290 |
| Molecular Formula | C19H37F3N6O2 |
| Molecular Weight | 438.54 g/mol |
| Exact Mass | 438.29 |
| IUPAC Name | 1-[4-[3-(methylamino)propylamino]-6-propan-2-yl-1,3-diazinan-2-yl]-3-[4-(trifluoromethoxy)cyclohexyl]urea |
| SMILES | CNCCCNC1CC(C(C)C)NC(NC(=O)NC2CCC(OC(F)(F)F)CC2)N1 |
| InChI | InChI=1S/C19H37F3N6O2/c1-12(2)15-11-16(24-10-4-9-23-3)27-17(26-15)28-18(29)25-13-5-7-14(8-6-13)30-19(20,21)22/h12-17,23-24,26-27H,4-11H2,1-3H3,(H2,25,28,29) |
| InChIKey | QTYPCWUXRRNQHE-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 98.48 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.54 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|