About 1-(4-chloro-1,3-diazinan-2-yl)-3-[4-(trifluoromethoxy)cyclohexyl]urea
1-(4-chloro-1,3-diazinan-2-yl)-3-[4-(trifluoromethoxy)cyclohexyl]urea (PubChem CID 142295405) has the molecular formula C12H20ClF3N4O2
and a molecular weight of 344.77 g/mol. Its IUPAC name is 1-(4-chloro-1,3-diazinan-2-yl)-3-[4-(trifluoromethoxy)cyclohexyl]urea.
Molecular Properties
| Compound Name | 1-(4-chloro-1,3-diazinan-2-yl)-3-[4-(trifluoromethoxy)cyclohexyl]urea |
| PubChem CID | 142295405 |
| Molecular Formula | C12H20ClF3N4O2 |
| Molecular Weight | 344.77 g/mol |
| Exact Mass | 344.12 |
| IUPAC Name | 1-(4-chloro-1,3-diazinan-2-yl)-3-[4-(trifluoromethoxy)cyclohexyl]urea |
| SMILES | O=C(NC1CCC(OC(F)(F)F)CC1)NC1NCCC(Cl)N1 |
| InChI | InChI=1S/C12H20ClF3N4O2/c13-9-5-6-17-10(19-9)20-11(21)18-7-1-3-8(4-2-7)22-12(14,15)16/h7-10,17,19H,1-6H2,(H2,18,20,21) |
| InChIKey | DXERZZCDRXJLRH-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 74.42 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 344.77 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|
Analyze 1-(4-chloro-1,3-diazinan-2-yl)-3-[4-(trifluoromethoxy)cyclohexyl]urea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(4-chloro-1,3-diazinan-2-yl)-3-[4-(trifluoromethoxy)cyclohexyl]urea?
The IUPAC name of 1-(4-chloro-1,3-diazinan-2-yl)-3-[4-(trifluoromethoxy)cyclohexyl]urea (CID 142295405) is 1-(4-chloro-1,3-diazinan-2-yl)-3-[4-(trifluoromethoxy)cyclohexyl]urea.
What is the SMILES notation for 1-(4-chloro-1,3-diazinan-2-yl)-3-[4-(trifluoromethoxy)cyclohexyl]urea?
The canonical SMILES for 1-(4-chloro-1,3-diazinan-2-yl)-3-[4-(trifluoromethoxy)cyclohexyl]urea is O=C(NC1CCC(OC(F)(F)F)CC1)NC1NCCC(Cl)N1.
What is the InChIKey of 1-(4-chloro-1,3-diazinan-2-yl)-3-[4-(trifluoromethoxy)cyclohexyl]urea?
The InChIKey is DXERZZCDRXJLRH-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H20ClF3N4O2/c13-9-5-6-17-10(19-9)20-11(21)18-7-1-3-8(4-2-7)22-12(14,15)16/h7-10,17,19H,1-6H2,(H2,18,20,21).
What are the key properties of 1-(4-chloro-1,3-diazinan-2-yl)-3-[4-(trifluoromethoxy)cyclohexyl]urea?
1-(4-chloro-1,3-diazinan-2-yl)-3-[4-(trifluoromethoxy)cyclohexyl]urea has a molecular weight of 344.77 g/mol, XLogP of 1.56, 3 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(4-chloro-1,3-diazinan-2-yl)-3-[4-(trifluoromethoxy)cyclohexyl]urea is sourced from PubChem (CID 142295405), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).