C30H27N3 — CID 142296251
(1Z,3E)-3-(7,8-diphenyl-7,8-diazabicyclo[4.2.0]octa-1(6),2,4-trien-3-yl)-1-phenylhexa-1,3-dien-1-amine (PubChem CID 142296251) has the molecular formula C30H27N3 and a molecular weight of 429.57 g/mol. Its IUPAC name is (1Z,3E)-3-(7,8-diphenyl-7,8-diazabicyclo[4.2.0]octa-1(6),2,4-trien-3-yl)-1-phenylhexa-1,3-dien-1-amine.
| Compound Name | (1Z,3E)-3-(7,8-diphenyl-7,8-diazabicyclo[4.2.0]octa-1(6),2,4-trien-3-yl)-1-phenylhexa-1,3-dien-1-amine |
|---|---|
| PubChem CID | 142296251 |
| Molecular Formula | C30H27N3 |
| Molecular Weight | 429.57 g/mol |
| Exact Mass | 429.22 |
| IUPAC Name | (1Z,3E)-3-(7,8-diphenyl-7,8-diazabicyclo[4.2.0]octa-1(6),2,4-trien-3-yl)-1-phenylhexa-1,3-dien-1-amine |
| SMILES | CC/C=C(\C=C(/N)c1ccccc1)c1ccc2c(c1)n(-c1ccccc1)n2-c1ccccc1 |
| InChI | InChI=1S/C30H27N3/c1-2-12-24(21-28(31)23-13-6-3-7-14-23)25-19-20-29-30(22-25)33(27-17-10-5-11-18-27)32(29)26-15-8-4-9-16-26/h3-22H,2,31H2,1H3/b24-12+,28-21- |
| InChIKey | VVKQIKGRGUGQPB-YQWJEYDZSA-N |
| XLogP | 7.21 |
| TPSA | 35.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.57 |
| LogP ≤ 5 | 7.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|