About 4-cyclopropyl-1,3-dimethyl-N-[(4-methylphenyl)methyl]-2-oxo-3H-quinoxaline-6-carboxamide
4-cyclopropyl-1,3-dimethyl-N-[(4-methylphenyl)methyl]-2-oxo-3H-quinoxaline-6-carboxamide (PubChem CID 142296553) has the molecular formula C22H25N3O2
and a molecular weight of 363.46 g/mol. Its IUPAC name is 4-cyclopropyl-1,3-dimethyl-N-[(4-methylphenyl)methyl]-2-oxo-3H-quinoxaline-6-carboxamide.
Molecular Properties
| Compound Name | 4-cyclopropyl-1,3-dimethyl-N-[(4-methylphenyl)methyl]-2-oxo-3H-quinoxaline-6-carboxamide |
| PubChem CID | 142296553 |
| Molecular Formula | C22H25N3O2 |
| Molecular Weight | 363.46 g/mol |
| Exact Mass | 363.19 |
| IUPAC Name | 4-cyclopropyl-1,3-dimethyl-N-[(4-methylphenyl)methyl]-2-oxo-3H-quinoxaline-6-carboxamide |
| SMILES | Cc1ccc(CNC(=O)c2ccc3c(c2)N(C2CC2)C(C)C(=O)N3C)cc1 |
| InChI | InChI=1S/C22H25N3O2/c1-14-4-6-16(7-5-14)13-23-21(26)17-8-11-19-20(12-17)25(18-9-10-18)15(2)22(27)24(19)3/h4-8,11-12,15,18H,9-10,13H2,1-3H3,(H,23,26) |
| InChIKey | HKQGQAOEAPANAK-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 363.46 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-cyclopropyl-1,3-dimethyl-N-[(4-methylphenyl)methyl]-2-oxo-3H-quinoxaline-6-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-cyclopropyl-1,3-dimethyl-N-[(4-methylphenyl)methyl]-2-oxo-3H-quinoxaline-6-carboxamide?
The IUPAC name of 4-cyclopropyl-1,3-dimethyl-N-[(4-methylphenyl)methyl]-2-oxo-3H-quinoxaline-6-carboxamide (CID 142296553) is 4-cyclopropyl-1,3-dimethyl-N-[(4-methylphenyl)methyl]-2-oxo-3H-quinoxaline-6-carboxamide.
What is the SMILES notation for 4-cyclopropyl-1,3-dimethyl-N-[(4-methylphenyl)methyl]-2-oxo-3H-quinoxaline-6-carboxamide?
The canonical SMILES for 4-cyclopropyl-1,3-dimethyl-N-[(4-methylphenyl)methyl]-2-oxo-3H-quinoxaline-6-carboxamide is Cc1ccc(CNC(=O)c2ccc3c(c2)N(C2CC2)C(C)C(=O)N3C)cc1.
What is the InChIKey of 4-cyclopropyl-1,3-dimethyl-N-[(4-methylphenyl)methyl]-2-oxo-3H-quinoxaline-6-carboxamide?
The InChIKey is HKQGQAOEAPANAK-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H25N3O2/c1-14-4-6-16(7-5-14)13-23-21(26)17-8-11-19-20(12-17)25(18-9-10-18)15(2)22(27)24(19)3/h4-8,11-12,15,18H,9-10,13H2,1-3H3,(H,23,26).
What are the key properties of 4-cyclopropyl-1,3-dimethyl-N-[(4-methylphenyl)methyl]-2-oxo-3H-quinoxaline-6-carboxamide?
4-cyclopropyl-1,3-dimethyl-N-[(4-methylphenyl)methyl]-2-oxo-3H-quinoxaline-6-carboxamide has a molecular weight of 363.46 g/mol, XLogP of 3.26, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-cyclopropyl-1,3-dimethyl-N-[(4-methylphenyl)methyl]-2-oxo-3H-quinoxaline-6-carboxamide is sourced from PubChem (CID 142296553), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).