About 2-(propylsulfonimidoyl)-7,9-dihydropurin-8-one
2-(propylsulfonimidoyl)-7,9-dihydropurin-8-one (PubChem CID 142296738) has the molecular formula C8H11N5O2S
and a molecular weight of 241.28 g/mol. Its IUPAC name is 2-(propylsulfonimidoyl)-7,9-dihydropurin-8-one.
Molecular Properties
| Compound Name | 2-(propylsulfonimidoyl)-7,9-dihydropurin-8-one |
| PubChem CID | 142296738 |
| Molecular Formula | C8H11N5O2S |
| Molecular Weight | 241.28 g/mol |
| Exact Mass | 241.06 |
| IUPAC Name | 2-(propylsulfonimidoyl)-7,9-dihydropurin-8-one |
| SMILES | [H]N=S(=O)(CCC)c1ncc2[nH]c(=O)[nH]c2n1 |
| InChI | InChI=1S/C8H11N5O2S/c1-2-3-16(9,15)8-10-4-5-6(13-8)12-7(14)11-5/h4,9H,2-3H2,1H3,(H2,10,11,12,13,14) |
| InChIKey | XEMSWCLTGRTCJX-UHFFFAOYSA-N |
| XLogP | 0.46 |
| TPSA | 115.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 241.28 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-(propylsulfonimidoyl)-7,9-dihydropurin-8-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(propylsulfonimidoyl)-7,9-dihydropurin-8-one?
The IUPAC name of 2-(propylsulfonimidoyl)-7,9-dihydropurin-8-one (CID 142296738) is 2-(propylsulfonimidoyl)-7,9-dihydropurin-8-one.
What is the SMILES notation for 2-(propylsulfonimidoyl)-7,9-dihydropurin-8-one?
The canonical SMILES for 2-(propylsulfonimidoyl)-7,9-dihydropurin-8-one is [H]N=S(=O)(CCC)c1ncc2[nH]c(=O)[nH]c2n1.
What is the InChIKey of 2-(propylsulfonimidoyl)-7,9-dihydropurin-8-one?
The InChIKey is XEMSWCLTGRTCJX-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H11N5O2S/c1-2-3-16(9,15)8-10-4-5-6(13-8)12-7(14)11-5/h4,9H,2-3H2,1H3,(H2,10,11,12,13,14).
What are the key properties of 2-(propylsulfonimidoyl)-7,9-dihydropurin-8-one?
2-(propylsulfonimidoyl)-7,9-dihydropurin-8-one has a molecular weight of 241.28 g/mol, XLogP of 0.46, 3 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(propylsulfonimidoyl)-7,9-dihydropurin-8-one is sourced from PubChem (CID 142296738), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).