About CID 142296921
CID 142296921 (PubChem CID 142296921) has the molecular formula C64H56BN2O2
and a molecular weight of 895.98 g/mol.
Molecular Properties
| Compound Name | CID 142296921 |
| PubChem CID | 142296921 |
| Molecular Formula | C64H56BN2O2 |
| Molecular Weight | 895.98 g/mol |
| Exact Mass | 895.44 |
| IUPAC Name | — |
| SMILES | CC1(C)c2ccccc2-c2ccc(-c3ccc(-c4ccccc4-c4cc([B]OC(C)(C)C(C)(C)O)cc(-c5ccccc5-c5ccc(-c6ccc7c(c6)C(C)(C)c6ccccc6-7)nc5)c4)cn3)cc21 |
| InChI | InChI=1S/C64H56BN2O2/c1-61(2)55-23-15-13-21-51(55)53-29-25-40(36-57(53)61)59-31-27-42(38-66-59)47-17-9-11-19-49(47)44-33-45(35-46(34-44)65-69-64(7,8)63(5,6)68)50-20-12-10-18-48(50)43-28-32-60(67-39-43)41-26-30-54-52-22-14-16-24-56(52)62(3,4)58(54)37-41/h9-39,68H,1-8H3 |
| InChIKey | DWLKDGISLCUOGV-UHFFFAOYSA-N |
| XLogP | 14.90 |
| TPSA | 55.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 69 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 895.98 |
| LogP ≤ 5 | 14.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 142296921 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 142296921?
The IUPAC name of CID 142296921 (CID 142296921) is not available.
What is the SMILES notation for CID 142296921?
The canonical SMILES for CID 142296921 is CC1(C)c2ccccc2-c2ccc(-c3ccc(-c4ccccc4-c4cc([B]OC(C)(C)C(C)(C)O)cc(-c5ccccc5-c5ccc(-c6ccc7c(c6)C(C)(C)c6ccccc6-7)nc5)c4)cn3)cc21.
What is the InChIKey of CID 142296921?
The InChIKey is DWLKDGISLCUOGV-UHFFFAOYSA-N. The full InChI is InChI=1S/C64H56BN2O2/c1-61(2)55-23-15-13-21-51(55)53-29-25-40(36-57(53)61)59-31-27-42(38-66-59)47-17-9-11-19-49(47)44-33-45(35-46(34-44)65-69-64(7,8)63(5,6)68)50-20-12-10-18-48(50)43-28-32-60(67-39-43)41-26-30-54-52-22-14-16-24-56(52)62(3,4)58(54)37-41/h9-39,68H,1-8H3.
What are the key properties of CID 142296921?
CID 142296921 has a molecular weight of 895.98 g/mol, XLogP of 14.90, 10 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for CID 142296921 is sourced from PubChem (CID 142296921), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).