About 4-[[(4-aminophenyl)methoxy-ethynylphosphanyl]oxymethyl]aniline;aniline
4-[[(4-aminophenyl)methoxy-ethynylphosphanyl]oxymethyl]aniline;aniline (PubChem CID 142297048) has the molecular formula C28H31N4O2P
and a molecular weight of 486.56 g/mol. Its IUPAC name is 4-[[(4-aminophenyl)methoxy-ethynylphosphanyl]oxymethyl]aniline;aniline.
Molecular Properties
| Compound Name | 4-[[(4-aminophenyl)methoxy-ethynylphosphanyl]oxymethyl]aniline;aniline |
| PubChem CID | 142297048 |
| Molecular Formula | C28H31N4O2P |
| Molecular Weight | 486.56 g/mol |
| Exact Mass | 486.22 |
| IUPAC Name | 4-[[(4-aminophenyl)methoxy-ethynylphosphanyl]oxymethyl]aniline;aniline |
| SMILES | C#CP(OCc1ccc(N)cc1)OCc1ccc(N)cc1.Nc1ccccc1.Nc1ccccc1 |
| InChI | InChI=1S/C16H17N2O2P.2C6H7N/c1-2-21(19-11-13-3-7-15(17)8-4-13)20-12-14-5-9-16(18)10-6-14;2*7-6-4-2-1-3-5-6/h1,3-10H,11-12,17-18H2;2*1-5H,7H2 |
| InChIKey | PUTOWNQWEWHOFO-UHFFFAOYSA-N |
| XLogP | 6.02 |
| TPSA | 122.54 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 486.56 |
| LogP ≤ 5 | 6.02 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 4-[[(4-aminophenyl)methoxy-ethynylphosphanyl]oxymethyl]aniline;aniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[[(4-aminophenyl)methoxy-ethynylphosphanyl]oxymethyl]aniline;aniline?
The IUPAC name of 4-[[(4-aminophenyl)methoxy-ethynylphosphanyl]oxymethyl]aniline;aniline (CID 142297048) is 4-[[(4-aminophenyl)methoxy-ethynylphosphanyl]oxymethyl]aniline;aniline.
What is the SMILES notation for 4-[[(4-aminophenyl)methoxy-ethynylphosphanyl]oxymethyl]aniline;aniline?
The canonical SMILES for 4-[[(4-aminophenyl)methoxy-ethynylphosphanyl]oxymethyl]aniline;aniline is C#CP(OCc1ccc(N)cc1)OCc1ccc(N)cc1.Nc1ccccc1.Nc1ccccc1.
What is the InChIKey of 4-[[(4-aminophenyl)methoxy-ethynylphosphanyl]oxymethyl]aniline;aniline?
The InChIKey is PUTOWNQWEWHOFO-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H17N2O2P.2C6H7N/c1-2-21(19-11-13-3-7-15(17)8-4-13)20-12-14-5-9-16(18)10-6-14;2*7-6-4-2-1-3-5-6/h1,3-10H,11-12,17-18H2;2*1-5H,7H2.
What are the key properties of 4-[[(4-aminophenyl)methoxy-ethynylphosphanyl]oxymethyl]aniline;aniline?
4-[[(4-aminophenyl)methoxy-ethynylphosphanyl]oxymethyl]aniline;aniline has a molecular weight of 486.56 g/mol, XLogP of 6.02, 6 rotatable bonds, 4 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[[(4-aminophenyl)methoxy-ethynylphosphanyl]oxymethyl]aniline;aniline is sourced from PubChem (CID 142297048), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).