C14H19N3O6 — CID 142297141
(3,5-dioxo-6-propyl-7,8-dihydropyrazino[1,2-b]pyridazin-4-yl)oxymethyl ethyl carbonate (PubChem CID 142297141) has the molecular formula C14H19N3O6 and a molecular weight of 325.32 g/mol. Its IUPAC name is (3,5-dioxo-6-propyl-7,8-dihydropyrazino[1,2-b]pyridazin-4-yl)oxymethyl ethyl carbonate.
| Compound Name | (3,5-dioxo-6-propyl-7,8-dihydropyrazino[1,2-b]pyridazin-4-yl)oxymethyl ethyl carbonate |
|---|---|
| PubChem CID | 142297141 |
| Molecular Formula | C14H19N3O6 |
| Molecular Weight | 325.32 g/mol |
| Exact Mass | 325.13 |
| IUPAC Name | (3,5-dioxo-6-propyl-7,8-dihydropyrazino[1,2-b]pyridazin-4-yl)oxymethyl ethyl carbonate |
| SMILES | CCCN1CCn2ncc(=O)c(OCOC(=O)OCC)c2C1=O |
| InChI | InChI=1S/C14H19N3O6/c1-3-5-16-6-7-17-11(13(16)19)12(10(18)8-15-17)22-9-23-14(20)21-4-2/h8H,3-7,9H2,1-2H3 |
| InChIKey | VIADUFUXJYRTGD-UHFFFAOYSA-N |
| XLogP | 0.62 |
| TPSA | 99.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.32 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|