C15H21N3O5 — CID 142297191
4-(1-ethoxyethenoxymethoxy)-6-propyl-7,8-dihydropyrazino[1,2-b]pyridazine-3,5-dione (PubChem CID 142297191) has the molecular formula C15H21N3O5 and a molecular weight of 323.35 g/mol. Its IUPAC name is 4-(1-ethoxyethenoxymethoxy)-6-propyl-7,8-dihydropyrazino[1,2-b]pyridazine-3,5-dione.
| Compound Name | 4-(1-ethoxyethenoxymethoxy)-6-propyl-7,8-dihydropyrazino[1,2-b]pyridazine-3,5-dione |
|---|---|
| PubChem CID | 142297191 |
| Molecular Formula | C15H21N3O5 |
| Molecular Weight | 323.35 g/mol |
| Exact Mass | 323.15 |
| IUPAC Name | 4-(1-ethoxyethenoxymethoxy)-6-propyl-7,8-dihydropyrazino[1,2-b]pyridazine-3,5-dione |
| SMILES | C=C(OCC)OCOc1c2n(ncc1=O)CCN(CCC)C2=O |
| InChI | InChI=1S/C15H21N3O5/c1-4-6-17-7-8-18-13(15(17)20)14(12(19)9-16-18)23-10-22-11(3)21-5-2/h9H,3-8,10H2,1-2H3 |
| InChIKey | YIQPOIXTLQFDTG-UHFFFAOYSA-N |
| XLogP | 0.97 |
| TPSA | 82.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.35 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|