C16H23N3O3 — CID 142297199
4-(4-methylpent-1-en-2-yloxy)-6-propyl-7,8-dihydropyrazino[1,2-b]pyridazine-3,5-dione (PubChem CID 142297199) has the molecular formula C16H23N3O3 and a molecular weight of 305.38 g/mol. Its IUPAC name is 4-(4-methylpent-1-en-2-yloxy)-6-propyl-7,8-dihydropyrazino[1,2-b]pyridazine-3,5-dione.
| Compound Name | 4-(4-methylpent-1-en-2-yloxy)-6-propyl-7,8-dihydropyrazino[1,2-b]pyridazine-3,5-dione |
|---|---|
| PubChem CID | 142297199 |
| Molecular Formula | C16H23N3O3 |
| Molecular Weight | 305.38 g/mol |
| Exact Mass | 305.17 |
| IUPAC Name | 4-(4-methylpent-1-en-2-yloxy)-6-propyl-7,8-dihydropyrazino[1,2-b]pyridazine-3,5-dione |
| SMILES | C=C(CC(C)C)Oc1c2n(ncc1=O)CCN(CCC)C2=O |
| InChI | InChI=1S/C16H23N3O3/c1-5-6-18-7-8-19-14(16(18)21)15(13(20)10-17-19)22-12(4)9-11(2)3/h10-11H,4-9H2,1-3H3 |
| InChIKey | LGTNYKRIWBDXBL-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 64.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.38 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|