C17H23F3N2 — CID 142297285
(2Z,4E,6E,8Z)-6-methyl-5-(methylideneamino)-7-propan-2-yl-4-(trifluoromethyl)undeca-2,4,6,8,10-pentaen-1-amine (PubChem CID 142297285) has the molecular formula C17H23F3N2 and a molecular weight of 312.38 g/mol. Its IUPAC name is (2Z,4E,6E,8Z)-6-methyl-5-(methylideneamino)-7-propan-2-yl-4-(trifluoromethyl)undeca-2,4,6,8,10-pentaen-1-amine.
| Compound Name | (2Z,4E,6E,8Z)-6-methyl-5-(methylideneamino)-7-propan-2-yl-4-(trifluoromethyl)undeca-2,4,6,8,10-pentaen-1-amine |
|---|---|
| PubChem CID | 142297285 |
| Molecular Formula | C17H23F3N2 |
| Molecular Weight | 312.38 g/mol |
| Exact Mass | 312.18 |
| IUPAC Name | (2Z,4E,6E,8Z)-6-methyl-5-(methylideneamino)-7-propan-2-yl-4-(trifluoromethyl)undeca-2,4,6,8,10-pentaen-1-amine |
| SMILES | C=C/C=C\C(=C(C)\C(N=C)=C(\C=C/CN)C(F)(F)F)C(C)C |
| InChI | InChI=1S/C17H23F3N2/c1-6-7-9-14(12(2)3)13(4)16(22-5)15(10-8-11-21)17(18,19)20/h6-10,12H,1,5,11,21H2,2-4H3/b9-7-,10-8-,14-13-,16-15+ |
| InChIKey | QWBIQBZAHBDTRA-JHCOQLGLSA-N |
| XLogP | 4.73 |
| TPSA | 38.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.38 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|