C17H21F2N3 — CID 142297353
1-N-[2-(2,4-difluorophenyl)-2-methylpropyl]-4-N-methylbenzene-1,2,4-triamine (PubChem CID 142297353) has the molecular formula C17H21F2N3 and a molecular weight of 305.37 g/mol. Its IUPAC name is 1-N-[2-(2,4-difluorophenyl)-2-methylpropyl]-4-N-methylbenzene-1,2,4-triamine.
| Compound Name | 1-N-[2-(2,4-difluorophenyl)-2-methylpropyl]-4-N-methylbenzene-1,2,4-triamine |
|---|---|
| PubChem CID | 142297353 |
| Molecular Formula | C17H21F2N3 |
| Molecular Weight | 305.37 g/mol |
| Exact Mass | 305.17 |
| IUPAC Name | 1-N-[2-(2,4-difluorophenyl)-2-methylpropyl]-4-N-methylbenzene-1,2,4-triamine |
| SMILES | CNc1ccc(NCC(C)(C)c2ccc(F)cc2F)c(N)c1 |
| InChI | InChI=1S/C17H21F2N3/c1-17(2,13-6-4-11(18)8-14(13)19)10-22-16-7-5-12(21-3)9-15(16)20/h4-9,21-22H,10,20H2,1-3H3 |
| InChIKey | IFXKITJNBHAYPD-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 50.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.37 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|