C19H25FN2 — CID 142297378
1-N-[2-(4-fluorophenyl)-2-methylpropyl]-2-propylbenzene-1,4-diamine (PubChem CID 142297378) has the molecular formula C19H25FN2 and a molecular weight of 300.42 g/mol. Its IUPAC name is 1-N-[2-(4-fluorophenyl)-2-methylpropyl]-2-propylbenzene-1,4-diamine.
| Compound Name | 1-N-[2-(4-fluorophenyl)-2-methylpropyl]-2-propylbenzene-1,4-diamine |
|---|---|
| PubChem CID | 142297378 |
| Molecular Formula | C19H25FN2 |
| Molecular Weight | 300.42 g/mol |
| Exact Mass | 300.20 |
| IUPAC Name | 1-N-[2-(4-fluorophenyl)-2-methylpropyl]-2-propylbenzene-1,4-diamine |
| SMILES | CCCc1cc(N)ccc1NCC(C)(C)c1ccc(F)cc1 |
| InChI | InChI=1S/C19H25FN2/c1-4-5-14-12-17(21)10-11-18(14)22-13-19(2,3)15-6-8-16(20)9-7-15/h6-12,22H,4-5,13,21H2,1-3H3 |
| InChIKey | MMZVJFWTBHKVIW-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.42 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|