About [5-(hydroxymethyl)-7-oxabicyclo[4.2.0]octa-1(6),2,4-trien-3-yl]methanol
[5-(hydroxymethyl)-7-oxabicyclo[4.2.0]octa-1(6),2,4-trien-3-yl]methanol (PubChem CID 142297625) has the molecular formula C9H10O3
and a molecular weight of 166.18 g/mol. Its IUPAC name is [5-(hydroxymethyl)-7-oxabicyclo[4.2.0]octa-1(6),2,4-trien-3-yl]methanol.
Molecular Properties
| Compound Name | [5-(hydroxymethyl)-7-oxabicyclo[4.2.0]octa-1(6),2,4-trien-3-yl]methanol |
| PubChem CID | 142297625 |
| Molecular Formula | C9H10O3 |
| Molecular Weight | 166.18 g/mol |
| Exact Mass | 166.06 |
| IUPAC Name | [5-(hydroxymethyl)-7-oxabicyclo[4.2.0]octa-1(6),2,4-trien-3-yl]methanol |
| SMILES | OCc1cc(CO)c2c(c1)CO2 |
| InChI | InChI=1S/C9H10O3/c10-3-6-1-7(4-11)9-8(2-6)5-12-9/h1-2,10-11H,3-5H2 |
| InChIKey | QETJFNJVSQBMSB-UHFFFAOYSA-N |
| XLogP | 0.56 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 166.18 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze [5-(hydroxymethyl)-7-oxabicyclo[4.2.0]octa-1(6),2,4-trien-3-yl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [5-(hydroxymethyl)-7-oxabicyclo[4.2.0]octa-1(6),2,4-trien-3-yl]methanol?
The IUPAC name of [5-(hydroxymethyl)-7-oxabicyclo[4.2.0]octa-1(6),2,4-trien-3-yl]methanol (CID 142297625) is [5-(hydroxymethyl)-7-oxabicyclo[4.2.0]octa-1(6),2,4-trien-3-yl]methanol.
What is the SMILES notation for [5-(hydroxymethyl)-7-oxabicyclo[4.2.0]octa-1(6),2,4-trien-3-yl]methanol?
The canonical SMILES for [5-(hydroxymethyl)-7-oxabicyclo[4.2.0]octa-1(6),2,4-trien-3-yl]methanol is OCc1cc(CO)c2c(c1)CO2.
What is the InChIKey of [5-(hydroxymethyl)-7-oxabicyclo[4.2.0]octa-1(6),2,4-trien-3-yl]methanol?
The InChIKey is QETJFNJVSQBMSB-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10O3/c10-3-6-1-7(4-11)9-8(2-6)5-12-9/h1-2,10-11H,3-5H2.
What are the key properties of [5-(hydroxymethyl)-7-oxabicyclo[4.2.0]octa-1(6),2,4-trien-3-yl]methanol?
[5-(hydroxymethyl)-7-oxabicyclo[4.2.0]octa-1(6),2,4-trien-3-yl]methanol has a molecular weight of 166.18 g/mol, XLogP of 0.56, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [5-(hydroxymethyl)-7-oxabicyclo[4.2.0]octa-1(6),2,4-trien-3-yl]methanol is sourced from PubChem (CID 142297625), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).