C27H40N6O — CID 142299291
ethane;prop-1-ene;N'-[4-[8-(1,2,4-triazol-1-yl)octoxy]phenyl]pyridine-2-carboximidamide (PubChem CID 142299291) has the molecular formula C27H40N6O and a molecular weight of 464.66 g/mol. Its IUPAC name is ethane;prop-1-ene;N'-[4-[8-(1,2,4-triazol-1-yl)octoxy]phenyl]pyridine-2-carboximidamide.
| Compound Name | ethane;prop-1-ene;N'-[4-[8-(1,2,4-triazol-1-yl)octoxy]phenyl]pyridine-2-carboximidamide |
|---|---|
| PubChem CID | 142299291 |
| Molecular Formula | C27H40N6O |
| Molecular Weight | 464.66 g/mol |
| Exact Mass | 464.33 |
| IUPAC Name | ethane;prop-1-ene;N'-[4-[8-(1,2,4-triazol-1-yl)octoxy]phenyl]pyridine-2-carboximidamide |
| SMILES | C=CC.CC.N/C(=N\c1ccc(OCCCCCCCCn2cncn2)cc1)c1ccccn1 |
| InChI | InChI=1S/C22H28N6O.C3H6.C2H6/c23-22(21-9-5-6-14-25-21)27-19-10-12-20(13-11-19)29-16-8-4-2-1-3-7-15-28-18-24-17-26-28;1-3-2;1-2/h5-6,9-14,17-18H,1-4,7-8,15-16H2,(H2,23,27);3H,1H2,2H3;1-2H3 |
| InChIKey | XRBUJOCOUVQQEQ-UHFFFAOYSA-N |
| XLogP | 6.35 |
| TPSA | 91.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.66 |
| LogP ≤ 5 | 6.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|