C11H10N4O3 — CID 14229988
3-methylspiro[1H-quinazoline-4,5'-imidazolidine]-2,2',4'-trione (PubChem CID 14229988) has the molecular formula C11H10N4O3 and a molecular weight of 246.23 g/mol. Its IUPAC name is 3-methylspiro[1H-quinazoline-4,5'-imidazolidine]-2,2',4'-trione.
| Compound Name | 3-methylspiro[1H-quinazoline-4,5'-imidazolidine]-2,2',4'-trione |
|---|---|
| PubChem CID | 14229988 |
| Molecular Formula | C11H10N4O3 |
| Molecular Weight | 246.23 g/mol |
| Exact Mass | 246.08 |
| IUPAC Name | 3-methylspiro[1H-quinazoline-4,5'-imidazolidine]-2,2',4'-trione |
| SMILES | CN1C(=O)Nc2ccccc2C12NC(=O)NC2=O |
| InChI | InChI=1S/C11H10N4O3/c1-15-10(18)12-7-5-3-2-4-6(7)11(15)8(16)13-9(17)14-11/h2-5H,1H3,(H,12,18)(H2,13,14,16,17) |
| InChIKey | WTRHXNHBRZONAP-UHFFFAOYSA-N |
| XLogP | 0.16 |
| TPSA | 90.54 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.23 |
| LogP ≤ 5 | 0.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|