C28H56B2O4S2 — CID 142299980
4,4,5,5-tetramethyl-2-[5-[6-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pentylsulfanyl]hexylsulfanyl]pentyl]-1,3,2-dioxaborolane (PubChem CID 142299980) has the molecular formula C28H56B2O4S2 and a molecular weight of 542.51 g/mol. Its IUPAC name is 4,4,5,5-tetramethyl-2-[5-[6-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pentylsulfanyl]hexylsulfanyl]pentyl]-1,3,2-dioxaborolane.
| Compound Name | 4,4,5,5-tetramethyl-2-[5-[6-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pentylsulfanyl]hexylsulfanyl]pentyl]-1,3,2-dioxaborolane |
|---|---|
| PubChem CID | 142299980 |
| Molecular Formula | C28H56B2O4S2 |
| Molecular Weight | 542.51 g/mol |
| Exact Mass | 542.38 |
| IUPAC Name | 4,4,5,5-tetramethyl-2-[5-[6-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pentylsulfanyl]hexylsulfanyl]pentyl]-1,3,2-dioxaborolane |
| SMILES | CC1(C)OB(CCCCCSCCCCCCSCCCCCB2OC(C)(C)C(C)(C)O2)OC1(C)C |
| InChI | InChI=1S/C28H56B2O4S2/c1-25(2)26(3,4)32-29(31-25)19-13-11-17-23-35-21-15-9-10-16-22-36-24-18-12-14-20-30-33-27(5,6)28(7,8)34-30/h9-24H2,1-8H3 |
| InChIKey | FGCMBOCMNYSGBR-UHFFFAOYSA-N |
| XLogP | 8.54 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.51 |
| LogP ≤ 5 | 8.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|