C11H12FNO — CID 142301736
7-fluoro-1,4-dimethyl-3,4-dihydroquinolin-2-one (PubChem CID 142301736) has the molecular formula C11H12FNO and a molecular weight of 193.22 g/mol. Its IUPAC name is 7-fluoro-1,4-dimethyl-3,4-dihydroquinolin-2-one.
| Compound Name | 7-fluoro-1,4-dimethyl-3,4-dihydroquinolin-2-one |
|---|---|
| PubChem CID | 142301736 |
| Molecular Formula | C11H12FNO |
| Molecular Weight | 193.22 g/mol |
| Exact Mass | 193.09 |
| IUPAC Name | 7-fluoro-1,4-dimethyl-3,4-dihydroquinolin-2-one |
| SMILES | CC1CC(=O)N(C)c2cc(F)ccc21 |
| InChI | InChI=1S/C11H12FNO/c1-7-5-11(14)13(2)10-6-8(12)3-4-9(7)10/h3-4,6-7H,5H2,1-2H3 |
| InChIKey | NEQRPOFGCSJOJJ-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.22 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |