About 3-[3-(4-fluorophenyl)propyl]-5-propan-2-yl-1-oxa-5-azaspiro[5.5]undeca-7,10-diene-4,9-dione
3-[3-(4-fluorophenyl)propyl]-5-propan-2-yl-1-oxa-5-azaspiro[5.5]undeca-7,10-diene-4,9-dione (PubChem CID 142301855) has the molecular formula C21H24FNO3
and a molecular weight of 357.43 g/mol. Its IUPAC name is 3-[3-(4-fluorophenyl)propyl]-5-propan-2-yl-1-oxa-5-azaspiro[5.5]undeca-7,10-diene-4,9-dione.
Molecular Properties
| Compound Name | 3-[3-(4-fluorophenyl)propyl]-5-propan-2-yl-1-oxa-5-azaspiro[5.5]undeca-7,10-diene-4,9-dione |
| PubChem CID | 142301855 |
| Molecular Formula | C21H24FNO3 |
| Molecular Weight | 357.43 g/mol |
| Exact Mass | 357.17 |
| IUPAC Name | 3-[3-(4-fluorophenyl)propyl]-5-propan-2-yl-1-oxa-5-azaspiro[5.5]undeca-7,10-diene-4,9-dione |
| SMILES | CC(C)N1C(=O)C(CCCc2ccc(F)cc2)COC12C=CC(=O)C=C2 |
| InChI | InChI=1S/C21H24FNO3/c1-15(2)23-20(25)17(5-3-4-16-6-8-18(22)9-7-16)14-26-21(23)12-10-19(24)11-13-21/h6-13,15,17H,3-5,14H2,1-2H3 |
| InChIKey | DZFKQFLMZOPPNF-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 357.43 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-[3-(4-fluorophenyl)propyl]-5-propan-2-yl-1-oxa-5-azaspiro[5.5]undeca-7,10-diene-4,9-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[3-(4-fluorophenyl)propyl]-5-propan-2-yl-1-oxa-5-azaspiro[5.5]undeca-7,10-diene-4,9-dione?
The IUPAC name of 3-[3-(4-fluorophenyl)propyl]-5-propan-2-yl-1-oxa-5-azaspiro[5.5]undeca-7,10-diene-4,9-dione (CID 142301855) is 3-[3-(4-fluorophenyl)propyl]-5-propan-2-yl-1-oxa-5-azaspiro[5.5]undeca-7,10-diene-4,9-dione.
What is the SMILES notation for 3-[3-(4-fluorophenyl)propyl]-5-propan-2-yl-1-oxa-5-azaspiro[5.5]undeca-7,10-diene-4,9-dione?
The canonical SMILES for 3-[3-(4-fluorophenyl)propyl]-5-propan-2-yl-1-oxa-5-azaspiro[5.5]undeca-7,10-diene-4,9-dione is CC(C)N1C(=O)C(CCCc2ccc(F)cc2)COC12C=CC(=O)C=C2.
What is the InChIKey of 3-[3-(4-fluorophenyl)propyl]-5-propan-2-yl-1-oxa-5-azaspiro[5.5]undeca-7,10-diene-4,9-dione?
The InChIKey is DZFKQFLMZOPPNF-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H24FNO3/c1-15(2)23-20(25)17(5-3-4-16-6-8-18(22)9-7-16)14-26-21(23)12-10-19(24)11-13-21/h6-13,15,17H,3-5,14H2,1-2H3.
What are the key properties of 3-[3-(4-fluorophenyl)propyl]-5-propan-2-yl-1-oxa-5-azaspiro[5.5]undeca-7,10-diene-4,9-dione?
3-[3-(4-fluorophenyl)propyl]-5-propan-2-yl-1-oxa-5-azaspiro[5.5]undeca-7,10-diene-4,9-dione has a molecular weight of 357.43 g/mol, XLogP of 3.42, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[3-(4-fluorophenyl)propyl]-5-propan-2-yl-1-oxa-5-azaspiro[5.5]undeca-7,10-diene-4,9-dione is sourced from PubChem (CID 142301855), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).